Feedback

 

acetate

Image of MNXM26
Properties
MNX_IDMNXM26
formulaC2H3O2
charge-1
mass59.0446
referencechebi:30089
InChIKeyQTBSBXVTEAMEQO-UHFFFAOYSA-M
InChIInChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1
SMILESCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of acetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ac
envipath:...efa015b481ea
Acetate
chebi:15366
chebi:22169
chebi:2387
chebi:40486
ACETIC ACID
AcOH
Acetic acid
CH3-COOH
CH3CO2H
E 260
E-260
E260
Essigsaeure
Ethanoic acid
Ethylic acid
HOAc
INS No. 260
MeCO2H
MeCOOH
Methanecarboxylic acid
QTBSBXVTEAMEQO-UHFFFAOYSA-N
acetic acid
acide acetique
ethoic acid
chebi:13704
chebi:22165
chebi:30089
chebi:40480
ACETATE ION
Azetat
CH3-COO(-)
Ethanoat
MeCO2 anion
QTBSBXVTEAMEQO-UHFFFAOYSA-M
acetate
acetic acid, ion(1-)
ethanoate
envipath:...91a3d615e3d8 compound 76
envipath:...3be380a9d3c0 Acetic acid
envipath:...9f03545032d2 compound 250
envipath:...163c627e9b4a compound 37936
envipath:...a516a0ead4b3 compound 40212
hmdb:HMDB00042 Acetic acid
acetic acid
kegg:C00033
kegg:D00010
Acetasol (TN)
Acetate
Acetic acid
Acetic acid (JP17/NF)
Acetic acid, glacial (USP)
Ethanoic acid
Glacial acetic acid (JP17)
lipidmaps:LMFA01010002 10.Methanecarboxylic acid
Acetic acid
C2:0
Vinegar acid
acetate
ethanoic acid
lipidmaps:LMFA01010002
metacyc:ACET ACET
acetate
acetic acid
ethanoic acid
reactome:113539 CH3COO-
Ethanoic acid
acetate
acetic acid
reactome:1524044
slm:000000449
acetate
reactome:2022890
reactome:29416
reactome:390305
Acetate
CH3COO-
Ethanoic acid
acetic acid
sabiork:1278 Acetate
Acetic acid
Ethanoic acid
Glacial acetic acid
seed:cpd00029 ACET
Acetate
Acetic acid
Ethanoic acid
Glacial acetic acid
ac
deprecated:MNXM96437
deprecated:MNXM96524