Feedback

 

nicotinate

Image of MNXM274
Properties
MNX_IDMNXM274
formulaC6H4NO2
charge-1
mass122.102
referencechebi:32544
InChIKeyPVNIIMVLHYAWGP-UHFFFAOYSA-M
InChIInChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/p-1
SMILES[O-]C(=O)c1cccnc1

This chemical compound does not exist in my selection



Occurrences of nicotinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:nac Nicotinate
chebi:14650
chebi:22851
chebi:25530
chebi:32544
3-pyridinecarboxylate
PVNIIMVLHYAWGP-UHFFFAOYSA-M
nicotinate
pyridine-3-carboxylate
chebi:15940
chebi:25538
chebi:44319
chebi:7559
3-Pyridinecarboxylic acid
3-Pyridylcarboxylic acid
3-carboxypyridine
NICOTINIC ACID
Niacin
Nicotinic acid
Nikotinsaeure
P.P. factor
PP factor
PVNIIMVLHYAWGP-UHFFFAOYSA-N
acide nicotinique
acido nicotinico
acidum nicotinicum
anti-pellagra vitamin
beta-pyridinecarboxylic acid
m-pyridinecarboxylic acid
nicotinic acid
pellagra preventive factor
pyridine-3-carboxylic acid
pyridine-beta-carboxylic acid
vitamin B3
envipath:...d4ed6b580217
envipath:...d318ef0efef6
compound 42121
hmdb:HMDB01488 Nicotinic acid
niacin
pyridine-3-carboxylic acid
kegg:C00253
kegg:D00049
3-Pyridinecarboxylic acid
Niacin
Niacin (USP)
Niacor (TN)
Niaspan (TN)
Nicotinate
Nicotinic acid
Nicotinic acid (JP17/INN)
metacyc:NIACINE 3-pyridinecarboxylate
3-pyridinecarboxylic acid
NIACINE
niacin
niacine
nicamin
nico-400-
nicobid
nicocap
nicolar
nicotinate
nicotinic acid
pyridine-3-carboxylate
vitamin B3
wampocap
reactome:197230 NCA
Niacin
Nicotinate
nicotinic acid
reactome:8869604 NCA
nicotinate
sabiork:1994 3-Pyridinecarboxylate
3-Pyridinecarboxylic acid
Niacin
Nicotinate
Nicotinic acid
seed:cpd00218 3-Pyridinecarboxylic acid
Niacin
Nicotinate
Nicotinic acid
nac
deprecated:MNXM90215