Feedback

 

(3S)-hydroxyadipyl-CoA

Image of MNXM2784
Properties
MNX_IDMNXM2784
formulaC27H39N7O20P3S
charge-5
mass906.622
referencechebi:132183
InChIKeyOTEACGAEDCIMBS-NOTSHUFBSA-I
InChIInChI=1S/C27H44N7O20P3S/c1-27(2,22(41)25(42)30-6-5-16(36)29-7-8-58-18(39)9-14(35)3-4-17(37)38)11-51-57(48,49)54-56(46,47)50-10-15-21(53-55(43,44)45)20(40)26(52-15)34-13-33-19-23(28)31-12-32-24(19)34/h12-15,20-22,26,35,40-41H,3-11H2,1-2H3,(H,29,36)(H,30,42)(H,37,38)(H,46,47)(H,48,49)(H2,28,31,32)(H2,43,44,45)/p-5/t14-,15+,20+,21+,22-,26+/m0/s1
SMILESCC(C)(COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C[C@@H](O)CCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (3S)-hydroxyadipyl-CoA in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hadpcoa
envipath:...d350969bc5f5
kegg:C14145
(3S)-3-Hydroxyadipyl-CoA
chebi:132183 (3S)-hydroxyadipyl-CoA
(3S)-hydroxyadipyl-CoA(5-)
OTEACGAEDCIMBS-NOTSHUFBSA-I
chebi:34002 (3S)-3-Hydroxyadipyl-CoA
OTEACGAEDCIMBS-PXUUTJOASA-N
chebi:70990 3'-phosphonatoadenosine 5'-{3-[(3R)-4-{[3-({2-[(5-carboxylato-3-hydroxypentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] diphosphate}
3-hydroxyadipyl-CoA
3-hydroxyadipyl-CoA(5-)
OTEACGAEDCIMBS-FOLKQPSDSA-I
chebi:71038 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(5-carboxy-3-hydroxypentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate}
3-hydroxyadipoyl-CoA
3-hydroxyadipoyl-coenzyme A
3-hydroxyadipyl-CoA
OTEACGAEDCIMBS-FOLKQPSDSA-N
S-(5-carboxy-3-hydroxypentanoyl)-CoA
S-(5-carboxy-3-hydroxypentanoyl)-coenzyme A
hmdb:HMDB12475 (3S)-3-Hydroxyadipyl-CoA
(4R)-6-({2-[3-(3-{[({[(2S,3R,4S,5S)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy(hydroxy)phosphoryl)oxy]methyl}-2-hydroxy-3-methylbutanamido)propanamido]ethyl}sulfanyl)-4-hydroxy-6-oxohexanoic acid
(4R)-6-{[2-(3-{3-[({[({[(2S,3R,4S,5S)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)methyl]-2-hydroxy-3-methylbutanamido}propanamido)ethyl]sulfanyl}-4-hydroxy-6-oxohexanoic acid
lipidmaps:LMFA07050117 (3S)-3-Hydroxyadipyl-CoA
(4R)-6-{[2-(3-{3-[({[({[(2S,3R,4S,5S)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)methyl]-2-hydroxy-3-methylbutanamido}propanamido)ethyl]sulfanyl}-4-hydroxy-6-oxohexanoic acid
lipidmaps:LMFA07050117
lipidmaps:LMFA07050211 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(5-carboxy-3-hydroxypentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate}
3-hydroxyadipoyl-CoA
3-hydroxyadipoyl-coenzyme A
3-hydroxyadipyl-CoA
S-(5-carboxy-3-hydroxypentanoyl)-CoA
S-(5-carboxy-3-hydroxypentanoyl)-coenzyme A
lipidmaps:LMFA07050211
metacyc:3-HYDROXYADIPYL-COA (3S)-hydroxyadipyl-CoA
3-HYDROXYADIPYL-COA
seed:cpd09844 (3S)-3-Hydroxyadipyl-CoA
3hadpcoa
deprecated:MNXM31118
deprecated:MNXM91033