My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

taurine

Image of MNXM282
Properties
MNX_IDMNXM282
formulaC2H7NO3S
charge0
mass125.147
referencechebi:507393
InChIKeyXOAAWQZATWQOTB-UHFFFAOYSA-N
InChIInChI=1S/C2H7NO3S/c3-1-2-7(4,5)6/h1-3H2,(H,4,5,6)
SMILES[NH3+]CCS([O-])(=O)=O

This chemical compound does not exist in my selection



Occurrences of taurine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:taur Taurine
chebi:15195
chebi:15891
chebi:26852
chebi:45877
chebi:9406
2-Aminoethanesulfonic acid
2-aminoethanesulfonic acid
2-aminoethyl sulfonate
Aminoethylsulfonic acid
Taurine
XOAAWQZATWQOTB-UHFFFAOYSA-N
beta-aminoethylsulfonic acid
taurine
chebi:32970 2-aminoethanesulfonate
XOAAWQZATWQOTB-UHFFFAOYSA-M
chebi:507393 2-ammonioethanesulfonate
2-azaniumylethane-1-sulfonate
XOAAWQZATWQOTB-UHFFFAOYSA-N
taurine
taurine zwitterion
hmdb:HMDB00251 2-aminoethane-1-sulfonic acid
Taurine
taurine
kegg:C00245
kegg:D00047
2-Aminoethanesulfonic acid
Aminoethylsulfonic acid
Aminoethylsulfonic acid (JAN)
Taurine
Taurine (JP17/USP/INN)
Taurine (TN)
metacyc:TAURINE 2-aminoethanesulfonate
2-aminoethanesulfonic acid
TAURINE
aminoetylsulphonic acid
ethylaminesulphonic acid
taufon
tauphon
taurine
reactome:159420 TAU
taurine
reactome:193463
reactome:194069
glycine
glycine; taurine
taurine
sabiork:1989 2-Aminoethanesulfonic acid
Aminoethylsulfonic acid
Taurine
seed:cpd00210 2-Aminoethanesulfonic acid
Aminoethylsulfonic acid
Taurine
taur
deprecated:MNXM2122
deprecated:MNXM4599
deprecated:MNXM93948