Feedback

 

(R)-lactate

Image of MNXM285
Properties
MNX_IDMNXM285
formulaC3H5O3
charge-1
mass89.0705
referencechebi:16004
InChIKeyJVTAAEKCZFNVCJ-UWTATZPHSA-M
InChIInChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1/t2-/m1/s1
SMILESC[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (R)-lactate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:lac__D D-Lactate
chebi:11001
chebi:16004
chebi:18684
(2R)-2-hydroxypropanoate
(R)-lactate
D-2-hydroxypropanoate
D-2-hydroxypropionate
D-lactate
JVTAAEKCZFNVCJ-UWTATZPHSA-M
chebi:341
chebi:42105
chebi:42111
chebi:43701
(-)-lactic acid
(2R)-2-hydroxypropanoic acid
(R)-(-)-lactic acid
(R)-lactic acid
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactic acid
D-Milchsaeure
D-lactic acid
JVTAAEKCZFNVCJ-UWTATZPHSA-N
LACTIC ACID
hmdb:HMDB00171
hmdb:HMDB01311
(2R)-2-hydroxypropanoic acid
D-Lactic acid
D-lactic acid
metacyc:D-LACTATE (R)-2-hydroxypropanate
(R)-lactate
D-LACTATE
D-lactate
kegg:C00256
sabiork:1997
(R)-Lactate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactate
D-Lactic acid
sabiork:2284 2-Hydroxypropanoic acid
2-Hydroxypropionic acid
Lactate
Lactic acid
seed:cpd00221 (R)-Lactate
D-2-Hydroxypropanoic acid
D-2-Hydroxypropionic acid
D-Lactate
D-Lactic acid
lac-D