My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

glycine

Image of MNXM29
Properties
MNX_IDMNXM29
formulaC2H5NO2
charge0
mass75.0666
referencechebi:57305
InChIKeyDHMQDGOQFOQNFH-UHFFFAOYSA-N
InChIInChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
SMILES[NH3+]CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of glycine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:gly
envipath:...0e48c8dcbb87
Glycine
chebi:132194 ((2)H5)glycine
(2H5)Glycine
DHMQDGOQFOQNFH-LGLHGEJLSA-N
glycine-d5
pentadeuterioglycine
pentadeuteroglycine
perdeuterioglycine
perdeuteroglycine
chebi:32507 DHMQDGOQFOQNFH-UHFFFAOYSA-O
H2gly(+)
NH3(+)-CH2-COOH
carboxymethanaminium
glycine cation
glycinium
chebi:32508 DHMQDGOQFOQNFH-UHFFFAOYSA-M
H2N-CH2-COO(-)
aminoacetate
gly(-)
glycinate
glycine anion
chebi:10792
chebi:14344
chebi:15428
chebi:24368
chebi:42964
chebi:5460
Aminoacetic acid
Aminoessigsaeure
DHMQDGOQFOQNFH-UHFFFAOYSA-N
G
GLYCINE
Gly
Glycin
Glycine
Glycocoll
Glykokoll
Glyzin
H2N-CH2-COOH
Hgly
Leimzucker
aminoacetic acid
aminoethanoic acid
glycine
chebi:57305 2-azaniumylacetate
DHMQDGOQFOQNFH-UHFFFAOYSA-N
glycine
glycine zwitterion
envipath:...858bd29cddaa compound 41421
hmdb:HMDB00123 2-aminoacetic acid
Glycine
glycine
kegg:C00037
kegg:D00011
Aminoacetic acid
Gly
Glycine
Glycine (JP17/USP)
metacyc:GLY G
GLY
aminoacetic acid
gly
glycine
reactome:113545
reactome:159549
reactome:193446
reactome:266029
Aminoacetic acid
Gly
glycine
glycine zwitterion
reactome:29424 Aminoacetic acid
Gly
L-glycine
glycine
glycine zwitterion
sabiork:66 Aminoacetic acid
Gly
Glycine
seed:cpd00033 Aminoacetic acid
Gly
Glycine
gly
deprecated:MNXM96416