My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(9Z,12Z)-octadecadienoate

Image of MNXM293
Properties
MNX_IDMNXM293
formulaC18H31O2
charge-1
mass279.4381
referencechebi:30245
InChIKeyOYHQOLUKZRVURQ-HZJYTTRNSA-M
InChIInChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9-
SMILESCCCCC\C=C/C\C=C/CCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (9Z,12Z)-octadecadienoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:lnlc Lnlc
chebi:17351
chebi:25047
chebi:42395
chebi:6479
(9Z,12Z)-Octadecadienoic acid
(9Z,12Z)-octadeca-9,12-dienoic acid
(Z,Z)-9,12-octadecadienoic acid
9-cis,12-cis-Octadecadienoic acid
9Z,12Z-octadecadienoic acid
C18:2 9c, 12c omega6 todos cis-9,12-octadienoico
C18:2, n-6,9 all-cis
LA
LINOLEIC ACID
Linoleic acid
OYHQOLUKZRVURQ-HZJYTTRNSA-N
acide cis-linoleique
acide linoleique
acido linoleico
all-cis-9,12-octadecadienoic acid
cis,cis-9,12-octadecadienoic acid
cis,cis-linoleic acid
cis-Delta(9,12)-octadecadienoic acid
linoleic acid
linolic acid
chebi:12272
chebi:14515
chebi:20826
chebi:30245
(9Z,12Z)-9,12-octadecadienoic acid, ion(1-)
(9Z,12Z)-octadeca-9,12-dienoate
(9Z,12Z)-octadecadienoate
(Z,Z)-9,12-octadecadienoic acid, ion(1-)
OYHQOLUKZRVURQ-HZJYTTRNSA-M
cis,cis-9,12-octadecadienoate
cis,cis-linoleate
cis-Delta(9,12)-octadecadienoate
linoleate
linoleic acid, ion(1-)
hmdb:HMDB00673 (9Z,12Z)-octadeca-9,12-dienoic acid
Linoleic acid
linoleic
kegg:C01595
seed:cpd01122
(9Z,12Z)-Octadecadienoic acid
9-cis,12-cis-Octadecadienoate
9-cis,12-cis-Octadecadienoic acid
Linoleate
Linoleic acid
lipidmaps:LMFA01030120 9Z,12Z-Linoleic acid
9Z,12Z-octadecadienoic acid
C18:2n-6,9
Linoleate
Linoleic acid
Telfairic acid
cis,cis-9,12-octadecadienoic acid
cis,cis-Linoleic acid
cis-9, cis-12-octadecadienoic acid
lipidmaps:LMFA01030120
lipidmaps:LMFA01030809 9Z,12Z-octadecadienoic acid(d4)
Linoleic acid(d4)
lipidmaps:LMFA01030809
metacyc:LINOLEIC_ACID (9Z,12Z)-octadeca-9,12-dienoate
9,12-linoleic acid
9-cis,12-cis-octadecadienoate
LINOLEIC_ACID
cis,cis-9,12-octadecadienoate
linoleate
linoleic acid
reactome:2046044 18:2(n-6)
LA
linoleate
linoleic acid
linoleic acid (LA)
sabiork:2298 (9Z,12Z)-Octadecadienoic acid
9,12-Octadecadienoic acid
9-cis,12-cis-Octadecadienoate
9-cis,12-cis-Octadecadienoic acid
Linoleate
Linoleic acid
slm:000000407 (9Z,12Z)-octadecadienoate
18:2(9Z,12Z)
Linoleate
deprecated:MNXM106203
deprecated:MNXM145598
deprecated:MNXM90329