My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(9Z)-octadecenoate

Image of MNXM306
Properties
MNX_IDMNXM306
formulaC18H33O2
charge-1
mass281.454
referencechebi:30823
InChIKeyZQPPMHVWECSIRJ-KTKRTIGZSA-M
InChIInChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9-
SMILESCCCCCCCC\C=C/CCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (9Z)-octadecenoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ocdcea Octadecenoate (n-C18:1)
chebi:14684
chebi:25663
chebi:30823
(9Z)-octadec-9-enoate
(9Z)-octadecenoate
(Z)-9-octadecenoic acid, ion(1-)
Oleat
ZQPPMHVWECSIRJ-KTKRTIGZSA-M
cis-9-octadecenoate
oleate
oleic acid anion
chebi:104361
chebi:16196
chebi:25664
chebi:44741
chebi:7741
(9Z)-Octadecenoic acid
(9Z)-octadec-9-enoic acid
(Z)-Octadec-9-enoic acid
18:1 n-9
18:1Delta9cis
C18:1 n-9
OLEIC ACID
Octadec-9-enoic acid
Oelsaeure
Oleate
Oleic acid
ZQPPMHVWECSIRJ-KTKRTIGZSA-N
cis-9-octadecenoic acid
cis-Delta(9)-octadecenoic acid
cis-oleic acid
oleic acid
kegg:C00712
kegg:D02315
(9Z)-Octadecenoic acid
(Z)-Octadec-9-enoic acid
Oleate
Oleic acid
Oleic acid (NF)
lipidmaps:LMFA01030002 9-octadecylenic acid
9Z-octadecenoic acid
C18:1n-9
Elaic acid
Elaidoic acid
Oleate
Oleic acid
cis-9-octadecenoic acid
cis-Oleate
cis-Oleic acid
lipidmaps:LMFA01030002
lipidmaps:LMFA01030763 9Z-octadecenoic acid (d5)
Oleic acid (d5)
lipidmaps:LMFA01030763
lipidmaps:LMFA01030810 9Z-octadecenoic acid(d2)
Oleic acid(d2)
lipidmaps:LMFA01030810
metacyc:OLEATE-CPD (9Z)-octadec-9-enoate
(9Z)-octadec-9-enoic acid
(9Z)-octadecenoate
(9Z)-octadecenoic acid
(Z)-octadec-9-enoic acid
18:1 n-9
18:1delta9cis
9-octadecenoic acid
C18:1 n-9
OLEATE-CPD
cis-9-octadecenoic acid
cis-delta9-octadecenoic acid
cis-oleic acid
octadec-9-enoic acid
octadecenoate (n-C18:1)
oleate
oleic acid
sabiork:2139 (Z)-9-Octadecenoic acid
(Z)-Octadec-9-enoic acid
Oleate
Oleic acid
sabiork:28897 cis-Oleic acid
seed:cpd00536 (9Z)-Octadecenoic acid
(Z)-Octadec-9-enoic acid
Oleate
Oleic acid
oleac
slm:000000418 (9Z)-octadecenoate
18:1(9Z)
Oleate
deprecated:MNXM107383
deprecated:MNXM107384