My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

tetradecanoate

Image of MNXM314
Properties
MNX_IDMNXM314
formulaC14H27O2
charge-1
mass227.3635
referencechebi:30807
InChIKeyTUNFSRHWOTWDNC-UHFFFAOYSA-M
InChIInChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1
SMILESCCCCCCCCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of tetradecanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:30807
chebi:35292
1-tetradecanecarboxylate
CH3-[CH2]12-COO(-)
TUNFSRHWOTWDNC-UHFFFAOYSA-M
Tetradecanoate
myristate
n-tetradecan-1-oate
n-tetradecoate
tetradecanoate
tetradecoate
chebi:26897
chebi:278516
chebi:28875
chebi:44232
chebi:7056
chebi:73168
1-tetradecanecarboxylic acid
14
14:0
14:00
C14
CH3-[CH2]12-COOH
MYRISTIC ACID
Myristic acid
Myristinsaeure
TUNFSRHWOTWDNC-UHFFFAOYSA-N
Tetradecanoic acid
acide tetradecanoique
myristic acid
n-Tetradecan-1-oic acid
n-Tetradecoic acid
n-tetradecanoic acid
tetradecanoic acid
tetradecoic acid
hmdb:HMDB00806 Myristic acid
myristic acid
tetradecanoic acid
kegg:C06424
sabiork:2890
Myristic acid
Tetradecanoate
Tetradecanoic acid
lipidmaps:LMFA01010014 C14:0
Myristic acid
lipidmaps:LMFA01010014
tetradecanoic acid
lipidmaps:LMFA01010044 Myristic acid(d3)
Tetradecanoic acid(d3)
lipidmaps:LMFA01010044
metacyc:CPD-7836 CPD-7836
myristate
myristic acid
tetradecanoate
tetradecanoic acid
tetradecoate
tetradecoic acid
seed:cpd03847 Myristic acid
Tetradecanoate
Tetradecanoic acid
tetradecanoate (C14,0)
tetradecanoate (n-C14,0)
ttdca
slm:000000825 Myristate
tetradecanoate
deprecated:MNXM106816