Feedback

 

indole-3-pyruvate

Image of MNXM315
Properties
MNX_IDMNXM315
formulaC11H8NO3
charge-1
mass202.1867
referencechebi:17640
InChIKeyRSTKLPZEZYGQPY-UHFFFAOYSA-M
InChIInChI=1S/C11H9NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H,14,15)/p-1
SMILES[O-]C(=O)C(=O)Cc1c[nH]c2ccccc12

This chemical compound does not exist in my selection



Occurrences of indole-3-pyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:indpyr Indolepyruvate
chebi:11113
chebi:11738
chebi:14454
chebi:17640
chebi:24816
chebi:29095
3-(1H-indol-3-yl)-2-oxopropanoate
3-(indol-3-yl)pyruvate
RSTKLPZEZYGQPY-UHFFFAOYSA-M
indole-3-pyruvate
chebi:24817
chebi:29750
chebi:39967
chebi:5917
3-(1H-indol-3-yl)-2-oxopropanoic acid
3-(indol-3-yl)pyruvic acid
Indolepyruvic acid
RSTKLPZEZYGQPY-UHFFFAOYSA-N
indole-3-pyruvic acid
hmdb:HMDB60484 3-(1H-indol-3-yl)-2-oxopropanoic acid
3-(indol-3-yl)pyruvic acid
Indolepyruvate
metacyc:INDOLE_PYRUVATE (indol-3-yl)pyruvate
3-(indol-3-yl)pyruvate
3-indole-2-oxopropanoate
INDOLE_PYRUVATE
IPA
indole-3-pyruvate
indole-pyr
indolepyruvate
indolepyruvic acid
reactome:893599 3-(indol-3-yl)pyruvic acid
3IN-PYRA
kegg:C00331
sabiork:5047
(Indol-3-yl)pyruvate
3-(Indol-3-yl)pyruvate
Indole-3-pyruvate
Indolepyruvate
Indolepyruvic acid
seed:cpd00278 (Indol-3-yl)pyruvate
3-(Indol-3-yl)pyruvate
Indole-3-pyruvate
Indolepyruvate
Indolepyruvic acid
indol-3-pyruvate
indpyr
deprecated:MNXM90174