Feedback

 

5,6,7,8-tetrahydrofolyl-L-glutamic acid

Image of MNXM317
Properties
MNX_IDMNXM317
formulaC24H27N8O9
charge-3
mass571.521
referencechebi:27650
InChIKeyZAOGJXDWOQXFBW-FGRDXJNISA-K
InChIInChI=1S/C24H30N8O9/c25-24-31-19-18(21(37)32-24)28-13(10-27-19)9-26-12-3-1-11(2-4-12)20(36)30-15(23(40)41)5-7-16(33)29-14(22(38)39)6-8-17(34)35/h1-4,13-15,26,28H,5-10H2,(H,29,33)(H,30,36)(H,34,35)(H,38,39)(H,40,41)(H4,25,27,31,32,37)/p-3/t13?,14-,15-/m0/s1
SMILESNc1nc(=O)c2NC(CNc3ccc(cc3)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC([O-])=O)C([O-])=O)C([O-])=O)CNc2[nH]1

This chemical compound does not exist in my selection



Occurrences of 5,6,7,8-tetrahydrofolyl-L-glutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:26909
chebi:27650
chebi:9483
5,6,7,8-tetrahydrofolyl-L-glutamic acid
N-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-gamma-glutamyl-L-glutamic acid
THF-L-glutamate
Tetrahydrofolyl-[Glu](2)
ZAOGJXDWOQXFBW-FGRDXJNISA-N
hmdb:HMDB06825 2-{4-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid
2-{4-[(4-{[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methyl]amino}phenyl)formamido]-4-carboxybutanamido}pentanedioic acid
Tetrahydrofolyl-[Glu](2)
kegg:C09332 (6S)-H4PteGlu2
THF-L-glutamate
Tetrahydropteroyldiglutamate
metacyc:CPD-17108 CPD-17108
H4PteGlu2
tetrahydropteroyl di-L-glutamate
seed:cpd19097 THF-L-glutamate
Tetrahydrofolyl-[Glu](2)
tetrahydrofolate glutamate