Feedback

 

D-glutamate

Image of MNXM331
Properties
MNX_IDMNXM331
formulaC5H8NO4
charge-1
mass146.1219
referencechebi:29986
InChIKeyWHUUTDBJXJRKMK-GSVOUGTGSA-M
InChIInChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m1/s1
SMILES[NH3+][C@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-glutamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glu__D D-Glutamate
chebi:12979
chebi:21022
chebi:29986
(2R)-2-ammoniopentanedioate
D-glutamate
D-glutamate(1-)
D-glutamic acid monoanion
WHUUTDBJXJRKMK-GSVOUGTGSA-M
hydrogen D-glutamate
chebi:15966
chebi:21023
chebi:4183
(2R)-2-aminopentanedioic acid
(R)-2-aminopentanedioic acid
D-2-Aminoglutaric acid
D-Glutamic acid
D-Glutaminic acid
D-Glutaminsaeure
D-glutamic acid
DGL
WHUUTDBJXJRKMK-GSVOUGTGSA-N
glutamic acid D-form
chebi:29989 (2R)-2-aminopentanedioate
D-glutamate
D-glutamate(2-)
D-glutamic acid dianion
WHUUTDBJXJRKMK-GSVOUGTGSA-L
hmdb:HMDB03339 (2R)-2-aminopentanedioic acid
D-Glutamic acid
D-glutamic acid
kegg:C00217
sabiork:1978
D-2-Aminoglutaric acid
D-Glutamate
D-Glutamic acid
D-Glutaminic acid
metacyc:D-GLT D-GLT
D-glu
D-glutamate
D-glutamic acid
seed:cpd00186 D-2-Aminoglutaric acid
D-Glutamate
D-Glutamic acid
D-Glutaminic acid
glu-D