My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(R)-mevalonate

Image of MNXM333
Properties
MNX_IDMNXM333
formulaC6H11O4
charge-1
mass147.1497
referencechebi:36464
InChIKeyKJTLQQUUPVSXIM-ZCFIWIBFSA-M
InChIInChI=1S/C6H12O4/c1-6(10,2-3-7)4-5(8)9/h7,10H,2-4H2,1H3,(H,8,9)/p-1/t6-/m1/s1
SMILESC[C@@](O)(CCO)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (R)-mevalonate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:mev__R R Mevalonate
chebi:25350 3,5-dihydroxy-3-methylpentanoate
KJTLQQUUPVSXIM-UHFFFAOYSA-M
mevalonate
mevalonate anion
chebi:25351 3,5-dihydroxy-3-methylpentanoic acid
DL-Mevalonic acid
KJTLQQUUPVSXIM-UHFFFAOYSA-N
MVA
RS-Mevalonic acid
mevalonic acid
chebi:17710
chebi:18691
chebi:345
(3R)-3,5-dihydroxy-3-methylpentanoic acid
(R)-3,5-dihydroxy-3-methylvaleric acid
(R)-Mevalonate
(R)-mevalonic acid
3,5-Dihydroxy-3-methylvaleric acid
KJTLQQUUPVSXIM-ZCFIWIBFSA-N
Mevalonic acid
chebi:11005
chebi:18690
chebi:36464
chebi:43870
(3R)-3,5-dihydroxy-3-methylpentanoate
(R)-Mevalonate
(R)-mevalonate
KJTLQQUUPVSXIM-ZCFIWIBFSA-M
hmdb:HMDB00227 3,5-dihydroxy-3-methylpentanoic acid
DL-mevalonic acid
Mevalonic acid
hmdb:HMDB59629 (3R)-3,5-dihydroxy-3-methylpentanoic acid
(R)-mevalonate
mevalonic acid
kegg:C00418 (R)-Mevalonate
3,5-Dihydroxy-3-methylvaleric acid
Mevalonic acid
lipidmaps:LMFA01050352 3,5-Dihydroxy-3-methylvaleric acid
3R-methyl-3,5-dihydroxy-pentanoic acid
Mevalonic acid
lipidmaps:LMFA01050352
metacyc:MEVALONATE (R)-mevalonate
MEVALONATE
mevalonate
mevalonic acid
reactome:191424 (R)-mevalonic acid
MVA
Mevalonate
sabiork:2044 (R)-Mevalonate
3,5-Dihydroxy-3-methylvaleric acid
sabiork:20969 Mevalonate
Mevalonic acid
seed:cpd00332 (R)-Mevalonate
3,5-Dihydroxy-3-methylvaleric acid
Mevalonic acid
mev-R
deprecated:MNXM8878
deprecated:MNXM89862