My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

D-gluconate

Image of MNXM341
Properties
MNX_IDMNXM341
formulaC6H11O7
charge-1
mass195.1479
referencechebi:18391
InChIKeyRGHNJXZEOKUKBD-SQOUGZDYSA-M
InChIInChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-gluconate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glcn D-Gluconate
bigg:glcn__D D Gluconate
chebi:12955
chebi:18391
chebi:20983
chebi:20985
2,3,4,5,6-pentahydroxyhexanoate
D-gluconate
Dextronate
Glycogenate
Glyconate
Maltonate
RGHNJXZEOKUKBD-SQOUGZDYSA-M
chebi:24265 gluconate
chebi:24266 gluconic acid
chebi:20986
chebi:33198
chebi:4157
chebi:42715
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
D-Gluconic acid
D-Gluconsaeure
D-Glukonsaeure
D-gluco-Hexonic acid
D-gluconic acid
Dextronic acid
GLUCONIC ACID
Gluconic acid
Glycogenic acid
Hexonic acid
Maltonic acid
RGHNJXZEOKUKBD-SQOUGZDYSA-N
hmdb:HMDB00625
hmdb:HMDB03373
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
Gluconic acid
gluconate
kegg:C00257 D-Gluconate
D-Gluconic acid
D-gluco-Hexonic acid
metacyc:GLUCONATE D-gluconate
D-gluconic acid
GLUCONATE
dextronic acid
maltonic acid
sabiork:1998 D-Gluco-hexonic acid
D-Gluconate
D-Gluconic acid
D-gluco-Hexonic acid
sabiork:23420 Gluconate
seed:cpd00222 D-Gluconate
D-Gluconic acid
D-gluco-Hexonic acid
GLCN
glcn
deprecated:MNXM55148
deprecated:MNXM55150