Feedback

 

octanoyl-CoA

Image of MNXM342
Properties
MNX_IDMNXM342
formulaC29H46N7O17P3S
charge-4
mass889.701
referencechebi:57386
InChIKeyKQMZYOXOBSXMII-CECATXLMSA-J
InChIInChI=1S/C29H50N7O17P3S/c1-4-5-6-7-8-9-20(38)57-13-12-31-19(37)10-11-32-27(41)24(40)29(2,3)15-50-56(47,48)53-55(45,46)49-14-18-23(52-54(42,43)44)22(39)28(51-18)36-17-35-21-25(30)33-16-34-26(21)36/h16-18,22-24,28,39-40H,4-15H2,1-3H3,(H,31,37)(H,32,41)(H,45,46)(H,47,48)(H2,30,33,34)(H2,42,43,44)/p-4/t18-,22-,23-,24+,28-/m1/s1
SMILESCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12

This chemical compound does not exist in my selection



Occurrences of octanoyl-CoA in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:occoa Octanoyl-CoA (n-C8:0CoA)
chebi:14681
chebi:15533
chebi:25651
chebi:41542
chebi:7724
3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(octanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl} dihydrogen diphosphate)
8:0-CoA
C8:0-CoA
Coenzyme A, S-octanoate
KQMZYOXOBSXMII-CECATXLMSA-N
Octanoyl-CoA
Octanoyl-coa
Octanoyl-coenzyme A
capryloyl-CoA
capryloyl-coenzyme A
octanoyl-CoA
octanoylcoenzyme A
octylyl-CoA
octylyl-coenzyme A
chebi:57386 3'-phosphonatoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(octanoylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl} diphosphate)
KQMZYOXOBSXMII-CECATXLMSA-J
capryloyl-CoA tetraanion
capryloyl-CoA(4-)
capryloyl-coenzyme A(4-)
octanoyl-CoA
octanoyl-CoA tetraanion
octanoyl-CoA(4-)
octanoyl-coenzyme A(4-)
hmdb:HMDB01070
hmdb:HMDB06257
Octanoyl-CoA
octanoyl-coenzyme A
{[5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({[hydroxy({3-hydroxy-2,2-dimethyl-3-[(2-{[2-(octanoylsulfanyl)ethyl]carbamoyl}ethyl)carbamoyl]propoxy})phosphoryl]oxy})phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid
lipidmaps:LMFA07050355 Octanoyl-CoA
lipidmaps:LMFA07050355
{[5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({[hydroxy({3-hydroxy-2,2-dimethyl-3-[(2-{[2-(octanoylsulfanyl)ethyl]carbamoyl}ethyl)carbamoyl]propoxy})phosphoryl]oxy})phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid
metacyc:CPD-196 CPD-196
Octanoyl-CoA (n-C8:0CoA)
capryloyl-CoA
octanoyl-CoA
envipath:...a38aca2708eb
kegg:C01944
reactome:390303
reactome:77337
sabiork:2341
Octanoyl-CoA
seed:cpd01335 Octanoyl-CoA
Octanoyl-CoA (n-C8,0CoA)
occoa
slm:000000707 octanoyl-CoA
deprecated:MNXM90034
deprecated:MNXM90272