Feedback

 

homogentisate

Image of MNXM345
Properties
MNX_IDMNXM345
formulaC8H7O4
charge-1
mass167.1393
referencechebi:16169
InChIKeyIGMNYECMUMZDDF-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1
SMILESOc1ccc(O)c(CC([O-])=O)c1

This chemical compound does not exist in my selection



Occurrences of homogentisate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:hgentis
envipath:...c39ba3e563bb
Homogentisate
chebi:11452
chebi:14410
chebi:16169
chebi:24615
(2,5-dihydroxyphenyl)acetate
IGMNYECMUMZDDF-UHFFFAOYSA-M
homogentisate
chebi:44744
chebi:44747
chebi:5755
(2,5-dihydroxyphenyl)acetic acid
2,5-Dihydroxyphenylacetic acid
2-(3,6-DIHYDROXYPHENYL)ACETIC ACID
Homogentisic acid
IGMNYECMUMZDDF-UHFFFAOYSA-N
homogentisic acid
hmdb:HMDB00130 2-(2,5-dihydroxyphenyl)acetic acid
Homogentisic acid
homogentisic acid
metacyc:HOMOGENTISATE 2,5-dihydroxyphenylacetate
HOMOGENTISATE
homogentisate
reactome:30337 2,5-Dihydroxyphenylacetate
HGTA
homogentisate
kegg:C00544
sabiork:5134
2,5-Dihydroxyphenylacetate
2,5-Dihydroxyphenylacetic acid
Homogentisate
Homogentisic acid
seed:cpd00426 2,5-Dihydroxyphenylacetate
2,5-Dihydroxyphenylacetic acid
Homogentisate
Homogentisic acid
hgentis
deprecated:MNXM89972