My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

propanoate

Image of MNXM356
Properties
MNX_IDMNXM356
formulaC3H5O2
charge-1
mass73.0711
referencechebi:17272
InChIKeyXBDQKXXYIPTUBI-UHFFFAOYSA-M
InChIInChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1
SMILESCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of propanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:14903
chebi:17272
chebi:26290
CH3-CH2-COO(-)
EtCO2 anion
XBDQKXXYIPTUBI-UHFFFAOYSA-M
carboxylatoethane
ethanecarboxylate
ethylformate
metacetonate
methylacetate
propanate
propanoate
propanoic acid, ion(1-)
propionate
pseudoacetate
chebi:26304
chebi:30768
chebi:45227
chebi:8476
CH3-CH2-COOH
PA
PROPANOIC ACID
Propanoic acid
Propionic acid
Propionsaeure
XBDQKXXYIPTUBI-UHFFFAOYSA-N
acide propanoique
acide propionique
carboxyethane
ethanecarboxylic acid
ethylformic acid
metacetonic acid
methylacetic acid
propanoic acid
propioic acid
propionic acid
propoic acid
pseudoacetic acid
envipath:...7796c66cf9d9 Propanoate
envipath:...93172a99dd2e compound 150
envipath:...a3f26551abdd compound 38031
hmdb:HMDB00237 Propionic acid
propanoic acid
kegg:C00163
kegg:D02310
Propanoate
Propanoic acid
Propionate
Propionic acid
Propionic acid (NF)
lipidmaps:LMFA01010003 C3:0
Ethanecarboxylic acid
Ethylformic acid
Methylacetic acid
Propionic acid
Pseudoacetic acid
lipidmaps:LMFA01010003
propanoic acid
propionate
metacyc:PROPIONATE PROPIONATE
ethylformic acid
methylacetic acid
propanoate
propionate
propionic acid
sabiork:1955 Propanoate
Propanoic acid
Propionate
Propionic acid
seed:cpd00141 Propanoate
Propanoic acid
Propionate
Propionate (n-C3,0)
Propionic acid
ppa
slm:000001194 propionate