My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3-hydroxyanthranilate

Image of MNXM359
Properties
MNX_IDMNXM359
formulaC7H6NO3
charge-1
mass152.128
referencechebi:36559
InChIKeyWJXSWCUQABXPFS-UHFFFAOYSA-M
InChIInChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,8H2,(H,10,11)/p-1
SMILESNc1c(O)cccc1C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-hydroxyanthranilate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hanthrn 3 Hydroxyanthranilate
chebi:11800
chebi:11826
chebi:20061
chebi:36559
2-amino-3-hydroxybenzoate
3-hydroxyanthranilate
WJXSWCUQABXPFS-UHFFFAOYSA-M
chebi:1536
chebi:15793
chebi:39887
2-Amino-3-hydroxy-benzoic acid
2-Amino-3-hydroxybenzoic acid
2-amino-3-hydroxybenzoic acid
3-Hydroxyanthranilic acid
3-Ohaa
3-Oxyanthranilic acid
3-hydroxyanthranilic acid
WJXSWCUQABXPFS-UHFFFAOYSA-N
chebi:61149 2,3-dihydro-3-oxoanthranilic acid
6-amino-5-oxocyclohexa-1,3-diene-1-carboxylic acid
RVCNGLBZLLWEIQ-UHFFFAOYSA-N
chebi:61150 2,3-dihydro-3-oxoanthranilate
6-amino-5-oxocyclohexa-1,3-diene-1-carboxylate
RVCNGLBZLLWEIQ-UHFFFAOYSA-M
envipath:...68d360249d35 3-Hydroxyanthranilate
hmdb:HMDB01476 2-amino-3-hydroxybenzoic acid
3-Hydroxyanthranilic acid
3-hydroxyanthranilic acid
metacyc:3-HYDROXY-ANTHRANILATE 2-amino-3-hydroxybenzoate
3-HYDROXY-ANTHRANILATE
3-hydroxyanthranilate
3-hydroxyanthranilic acid
metacyc:CPD-9520 2,3-dihydro-3-oxo-anthranilate
2,3-dihydro-3-oxo-anthranilic acid
CPD-9520
reactome:30487 3-Hydroxyanthranilate
3-hydroxyanthranilic acid
3HAA
kegg:C00632
sabiork:2126
3-Hydroxyanthranilate
3-Hydroxyanthranilic acid
seed:cpd00483 3-Hydroxyanthranilate
3-Hydroxyanthranilic acid
3hanthrn
seed:cpd25715 2,3-dihydro-3-oxo-anthranilate
2,3-dihydro-3-oxo-anthranilic acid
deprecated:MNXM34431
deprecated:MNXM90072