Feedback

 

salicylate

Image of MNXM378
Properties
MNX_IDMNXM378
formulaC7H5O3
charge-1
mass137.1133
referencechebi:30762
InChIKeyYGSDEFSMJLZEOE-UHFFFAOYSA-M
InChIInChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/p-1
SMILESOc1ccccc1C([O-])=O

This chemical compound does not exist in my selection



Occurrences of salicylate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:salc
envipath:...5127bda3dafe
Salicylate
chebi:16914
chebi:26597
chebi:45521
chebi:9006
2-HYDROXYBENZOIC ACID
2-carboxyphenol
2-hydroxybenzoic acid
Salicylic acid
YGSDEFSMJLZEOE-UHFFFAOYSA-N
o-Hydroxybenzoic acid
o-carboxyphenol
o-hydroxybenzoic acid
salicylic acid
chebi:15061
chebi:26595
chebi:30762
2-hydroxybenzoate
2-hydroxybenzoic acid ion(1-)
Salicylate
YGSDEFSMJLZEOE-UHFFFAOYSA-M
o-hydroxybenzoate
sal
salicylate
envipath:...674180bdc3d4 compound 43865
hmdb:HMDB01895 2-hydroxybenzoic acid
Salicylic acid
salicylic
kegg:C00805
kegg:D00097
Salicylate
Salicylic acid
Salicylic acid (JP17/USP)
Salicylic acid (TN)
o-Hydroxybenzoic acid
metacyc:CPD-110 2-HBA
2-hydroxybenzoate
2-hydroxybenzoic acid
CPD-110
SA
o-hydroxybenzoate
o-hydroxybenzoic acid
salicylate
salicylic acid
reactome:159559 SAL
Salicylate
salicylic acid
sabiork:2163 Salicylate
Salicylic acid
o-Hydroxybenzoate
o-Hydroxybenzoic acid
seed:cpd00599 SALC
Salicylate
Salicylic acid
o-Hydroxybenzoic acid
salc
deprecated:MNXM90496