My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(indol-3-yl)acetate

Image of MNXM383
Properties
MNX_IDMNXM383
formulaC10H8NO2
charge-1
mass174.1766
referencechebi:30854
InChIKeySEOVTRFCIGRIMH-UHFFFAOYSA-M
InChIInChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1
SMILES[O-]C(=O)Cc1c[nH]c2ccccc12

This chemical compound does not exist in my selection



Occurrences of (indol-3-yl)acetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ind3ac Indole 3 acetate
chebi:14447
chebi:14452
chebi:24801
chebi:30854
(indol-3-yl)acetate
1H-indol-3-ylacetate
2-(indol-3-yl)ethanoate
SEOVTRFCIGRIMH-UHFFFAOYSA-M
indole-3-acetate
chebi:16411
chebi:24802
chebi:5905
(Indol-3-yl)acetate
(indol-3-yl)acetic acid
1H-indol-3-ylacetic acid
2-(indol-3-yl)ethanoic acid
3-Indolylessigsaeure
IAA
IES
Indole-3-acetic acid
Indoleacetic acid
SEOVTRFCIGRIMH-UHFFFAOYSA-N
heteroauxin
indole-3-acetic acid
hmdb:HMDB00197 2-(1H-indol-3-yl)acetic acid
Indoleacetic acid
beta-indole-3-acetic acid
kegg:C00954 (Indol-3-yl)acetate
IAA
Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
metacyc:INDOLE_ACETATE_AUXIN (indol-3-yl)acetate
IAA
INDOLE_ACETATE_AUXIN
auxin
indole-3-acetate
indole-3-acetic acid
indoleacetate
indoleacetic acid
sabiork:5333 Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
seed:cpd00703 (Indol-3-yl)acetate
Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
ind3ac