Feedback

 

3-hydroxypyruvate

Image of MNXM392
Properties
MNX_IDMNXM392
formulaC3H3O4
charge-1
mass103.0541
referencechebi:17180
InChIKeyHHDDCCUIIUWNGJ-UHFFFAOYSA-M
InChIInChI=1S/C3H4O4/c4-1-2(5)3(6)7/h4H,1H2,(H,6,7)/p-1
SMILESOCC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-hydroxypyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:hpyr Hydroxypyruvate
chebi:11837
chebi:14425
chebi:17180
chebi:20082
3-hydroxy-2-oxopropanoate
3-hydroxypyruvate
HHDDCCUIIUWNGJ-UHFFFAOYSA-M
chebi:20083
chebi:30841
chebi:39999
chebi:5813
3-HYDROXYPYRUVIC ACID
3-Hydroxypyruvic acid
3-hydroxy-2-oxopropanoic acid
3-hydroxypyruvic acid
HHDDCCUIIUWNGJ-UHFFFAOYSA-N
Hydroxypyruvic acid
envipath:...8e2ca0503508 compound 657
envipath:...b17c4f9bd437 compound 37994
hmdb:HMDB01352 3-hydroxy-2-oxopropanoic acid
Hydroxypyruvic acid
hydroxypyruvic acid
kegg:C00168 3-Hydroxypyruvate
3-Hydroxypyruvic acid
Hydroxypyruvate
Hydroxypyruvic acid
metacyc:OH-PYR 3-hydroxypyruvate
OH-PYR
OH-pyr
OH-pyruvate
beta-hydroxypyruvate
hydroxypyruvate
sabiork:1959 3-Hydroxy-2-oxopropanoate
3-Hydroxypyruvate
3-Hydroxypyruvic acid
Hydroxypyruvate
Hydroxypyruvic acid
seed:cpd00145 3-Hydroxypyruvate
3-Hydroxypyruvic acid
Hydroxypyruvate
Hydroxypyruvic acid
hpyr