My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

dodecanoate

Image of MNXM402
Properties
MNX_IDMNXM402
formulaC12H23O2
charge-1
mass199.3104
referencechebi:18262
InChIKeyPOULHZVOKOAJMA-UHFFFAOYSA-M
InChIInChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/p-1
SMILESCCCCCCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of dodecanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:14187
chebi:18262
chebi:23863
1-undecanecarboxylate
C12 fatty acid anion
CH3-[CH2]10-COO(-)
POULHZVOKOAJMA-UHFFFAOYSA-M
dodecanoate
dodecoate
dodecylate
duodecyclate
duodecylate
laurate
laurostearate
n-dodecanoate
undecane-1-carboxylate
vulvate
chebi:23864
chebi:23865
chebi:30805
chebi:41882
chebi:4680
1-undecanecarboxylic acid
ABL
C12 fatty acid
C12:0
CH3-[CH2]10-COOH
Coconut oil fatty acids
DAO
Dodecanoic acid
Dodecylcarboxylate
Dodecylic acid
Duodecyclic acid
Duodecylic acid
LAURIC ACID
Lauric acid
Laurinsaeure
Laurostearic acid
N-dodecanoic acid
POULHZVOKOAJMA-UHFFFAOYSA-N
Undecane-1-carboxylic acid
Vulvic acid
dodecanoic acid
dodecoic acid
lauric acid
n-dodecanoic acid
envipath:...e3bf334e46ea Lauric acid
hmdb:HMDB00638 Dodecanoic acid
dodecanoic acid
lauric acid
kegg:C02679
kegg:D10714
Dodecanoate
Dodecanoic acid
Dodecylcarboxylate
Lauric acid
Lauric acid (NF)
lipidmaps:LMFA01010012 C12:0
Dodecanoate
Dodecylic acid
Lauric acid
dodecanoic acid
lipidmaps:LMFA01010012
n-Dodecanoic acid
lipidmaps:LMFA01010043 Dodecanoic acid(d3)
Lauric acid(d3)
lipidmaps:LMFA01010043
metacyc:DODECANOATE DODECANOATE
dodecanoate
dodecanoic acid
laurate
lauric acid
n-dodecanoic acid
tin II 2-ethylhexanoate
reactome:33549 DDCX
Dodecanoate
Dodecylcarboxylate
dodecanoic acid
lauric acid
sabiork:2488 Dodecanoate
Dodecanoic acid
Dodecylcarboxylate
Laurate
Lauric acid
seed:cpd01741 Dodecanoate
Dodecanoate (n-C12,0)
Dodecanoic acid
Dodecylcarboxylate
Lauric acid
ddca
dodecanoate (C12,0)
slm:000000719 Laurate
dodecanoate
deprecated:MNXM106081
deprecated:MNXM90360