My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

5-aminolevulinate

Image of MNXM405
Properties
MNX_IDMNXM405
formulaC5H9NO3
charge0
mass131.1299
referencechebi:356416
InChIKeyZGXJTSGNIOSYLO-UHFFFAOYSA-N
InChIInChI=1S/C5H9NO3/c6-3-4(7)1-2-5(8)9/h1-3,6H2,(H,8,9)
SMILES[NH3+]CC(=O)CCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of 5-aminolevulinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:5aop 5-Amino-4-oxopentanoate
chebi:12109 5-amino-4-oxopentanoate
5-aminolevulinate
ZGXJTSGNIOSYLO-UHFFFAOYSA-M
chebi:132970 4-carboxy-2-oxobutan-1-aminium
5-aminolevulinic acid cation
5-aminolevulinic acid(1+)
5-ammoniolevulinic acid
ZGXJTSGNIOSYLO-UHFFFAOYSA-O
chebi:17549
chebi:2034
chebi:20547
5-ALA
5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
5-Aminolevulinate
5-amino-4-oxopentanoic acid
5-aminolevulinic acid
ZGXJTSGNIOSYLO-UHFFFAOYSA-N
aminolevulinic acid
dALA
delta-ALA
delta-aminolevulinic acid
chebi:356416 5-aminolevulinate
5-ammonio-4-oxopentanoate
5-ammonio-4-oxovalerate
5-ammoniolevulinate
5-azaniumyl-4-oxopentanoate
ZGXJTSGNIOSYLO-UHFFFAOYSA-N
hmdb:HMDB01149 5-Aminolevulinic acid
5-amino-4-oxopentanoic acid
aminolevulinic acid
kegg:C00430
kegg:D07567
5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
5-Aminolevulinate
Aminolevulinic acid
lipidmaps:LMFA01100055 4-oxo-5-amino-pentanoic acid
5-amino-levulinic acid
lipidmaps:LMFA01100055
metacyc:5-AMINO-LEVULINATE 5-AMINO-LEVULINATE
5-amino-4-oxo-pentanoic acid
5-amino-4-oxopentanoate
5-amino-4-oxopentanoic acid
5-amino-levulinate
5-amino-levulinic acid
5-aminolevulinate
5-aminolevulinic acid
ALA
delta-aminolevulinate
delta-aminolevulinic acid
reactome:189466
reactome:189489
5-aminolevulinate
5-aminolevulinic acid
dALA
delta-Aminolevulinic acid
seed:cpd00338 5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
5-Aminolevulinate
5-amino-levulinate
5aop
deprecated:MNXM89827