Feedback

 

2-acetolactate

Image of MNXM426
Properties
MNX_IDMNXM426
formulaC5H7O4
charge-1
mass131.1072
referencechebi:57774
InChIKeyNMDWGEGFJUBKLB-UHFFFAOYSA-M
InChIInChI=1S/C5H8O4/c1-3(6)5(2,9)4(7)8/h9H,1-2H3,(H,7,8)/p-1
SMILESCC(=O)C(C)(O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2-acetolactate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:11495
chebi:16444
chebi:19433
chebi:983
2-Acetolactate
2-acetyllactic acid
2-hydroxy-2-methyl-3-oxobutanoic acid
NMDWGEGFJUBKLB-UHFFFAOYSA-N
chebi:57774 2-acetolactate
2-acetyllactate
2-acetyllactate anion
2-acetyllactate(1-)
2-hydroxy-2-methyl-3-oxobutanoate
NMDWGEGFJUBKLB-UHFFFAOYSA-M
envipath:...ad7907680f5d compound 1006
hmdb:HMDB06833 2-Acetolactate
2-acetyllactic acid
2-hydroxy-2-methyl-3-oxobutanoic acid
lipidmaps:LMFA01050472 2-Acetolactate
2-hydroxy-2-methyl-3-oxobutanoic acid
lipidmaps:LMFA01050472
kegg:C00900
sabiork:2182
2-Acetolactate
seed:cpd00668 (S)-2-Acetolactate
(S)-2-Hydroxy-2-methyl-3-oxobutanoate
2-Acetolactate
2-aceto-lactate
ALCTT
S-2-Acetolactate
alac-S