My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(E)-cinnamate

Image of MNXM438
Properties
MNX_IDMNXM438
formulaC9H7O2
charge-1
mass147.1512
referencechebi:15669
InChIKeyWBYWAXJHAXSJNI-VOTSOKGWSA-M
InChIInChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/p-1/b7-6+
SMILES[O-]C(=O)C=Cc1ccccc1

This chemical compound does not exist in my selection



Occurrences of (E)-cinnamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:cinnm Trans-Cinnamate
chebi:23248 3-phenyl-2-propenoate
3-phenyl-2-propenoic acid, ion(1-)
3-phenylacrylate
3-phenylprop-2-enoate
WBYWAXJHAXSJNI-UHFFFAOYSA-M
cinnamate
cinnamic acid, ion(1-)
chebi:10955
chebi:12871
chebi:12879
chebi:15669
chebi:27072
(2E)-3-phenylprop-2-enoate
(E)-cinnamate
WBYWAXJHAXSJNI-VOTSOKGWSA-M
trans-cinnamate
chebi:10720
chebi:27073
chebi:35697
chebi:45845
(2E)-3-phenyl-2-propenoic acid
(2E)-3-phenylacrylic acid
(2E)-3-phenylprop-2-enoic acid
(E)-3-phenyl-2-propenoic acid
(E)-Cinnamate
(E)-cinnamic acid
Benzeneacrylic acid
PHENYLETHYLENECARBOXYLIC ACID
WBYWAXJHAXSJNI-VOTSOKGWSA-N
trans-3-phenylacrylic acid
trans-Cinnamate
trans-Cinnamic acid
trans-Zimtsaeure
trans-beta-carboxystyrene
trans-cinnamic acid
chebi:23250
chebi:27386
chebi:3710
3-phenyl-2-propenoic acid
3-phenylacrylic acid
3-phenylprop-2-enoic acid
3-phenylpropenoic acid
Cinnamic acid
PhCH=CHCO2H
WBYWAXJHAXSJNI-UHFFFAOYSA-N
Zimtsaeure
benzenepropenoic acid
benzylideneacetic acid
beta-phenylacrylic acid
cinnamic acid
phenylacrylic acid
envipath:...348a10f4b73b Cinnamate
envipath:...a87768e9ba89 compound 44230
hmdb:HMDB00567 (2Z)-3-phenylprop-2-enoic acid
Cinnamic acid
cis-cinnamic acid
hmdb:HMDB00930 (2E)-3-phenylprop-2-enoic acid
cinnamic acid
trans-Cinnamic acid
kegg:C00423 (2E)-3-Phenylprop-2-enoate
(E)-Cinnamate
trans-Cinnamate
trans-Cinnamic acid
kegg:C10438
seed:cpd07326
Benzeneacrylic acid
Cinnamic acid
metacyc:CPD-674 (E)-cinnamate
3-phenyl-2-propenoic acid
CPD-674
beta-phenylacrylic acid
cinnamate
cinnamic acid
trans-cinnamate
trans-cinnamic acid
sabiork:12522 Cinnamic acid
sabiork:5085 trans-Cinnamate
trans-Cinnamic acid
seed:cpd00333 (E)-Cinnamate
cinnm
trans-Cinnamate
trans-Cinnamic acid