My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(S)-3-methyl-2-oxopentanoate

Image of MNXM439
Properties
MNX_IDMNXM439
formulaC6H9O3
charge-1
mass129.1344
referencechebi:35146
InChIKeyJVQYSWDUAOAHFM-BYPYZUCNSA-M
InChIInChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/p-1/t4-/m0/s1
SMILESCC[C@H](C)C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-3-methyl-2-oxopentanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3mop (S)-3-Methyl-2-oxopentanoate
chebi:15614
chebi:18567
chebi:213
chebi:401
(3S)-2-oxo-3-methyl-n-valeric acid
(3S)-3-Methyl-2-oxopentanoic acid
(3S)-3-methyl-2-oxopentanoic acid
(S)-2-oxo-3-methylpentanoic acid
(S)-3-Methyl-2-oxopentanoate
(S)-3-Methyl-2-oxopentanoic acid
(S)-3-methyl-2-oxovaleric acid
(S)-OMV
JVQYSWDUAOAHFM-BYPYZUCNSA-N
chebi:10888
chebi:11049
chebi:18568
chebi:18755
chebi:35146
(3S)-3-Methyl-2-oxopentanoate
(3S)-3-methyl-2-oxopentanoate
(S)-3-methyl-2-oxopentanoate
(S)-3-methyl-2-oxovalerate
JVQYSWDUAOAHFM-BYPYZUCNSA-M
kegg:C00671 (3S)-3-Methyl-2-oxopentanoate
(3S)-3-Methyl-2-oxopentanoic acid
(S)-3-Methyl-2-oxopentanoate
(S)-3-Methyl-2-oxopentanoic acid
lipidmaps:LMFA01020275 3S-methyl-2-oxo-pentanoic acid
lipidmaps:LMFA01020275
metacyc:2-KETO-3-METHYL-VALERATE (3S)-3-methyl-2-oxopentanoate
(S)-2-oxo-3-methylpentanoate
(S)-3-methyl-2-oxopentanoate
(S)-3-methyl-2-oxovalerate
2-KETO-3-METHYL-VALERATE
2-keto-3-methyl-valerate
2-keto-isoleucine
2-oxo-3-methylpentanoate
2-oxo-3-methylvalerate
3-methyl-2-oxopentanoate
alpha-keto-beta-methyl-valerate
alpha-keto-methylvalerate
sabiork:5174 (3S)-3-Methyl-2-oxopentanoate
(3S)-3-Methyl-2-oxopentanoic acid
(S)-3-Methyl-2-oxopentanoate
seed:cpd00508 (3S)-3-Methyl-2-oxopentanoate
(3S)-3-Methyl-2-oxopentanoic acid
(S)-3-Methyl-2-oxopentanoate
(S)-3-Methyl-2-oxopentanoic acid
2-Oxo-3-methylvalerate
2-keto-3-methyl-valerate
2-keto-3-methylvalerate
3-Methyl-2-oxopentanoate
3MOP
3mop
S-3-Methyl-2-oxopentanoate
deprecated:MNXM114147