Feedback

 

cholate

Image of MNXM450
Properties
MNX_IDMNXM450
formulaC24H39O5
charge-1
mass407.564
referencechebi:29747
InChIKeyBHQCQFFYRZLCQQ-OELDTZBJSA-M
InChIInChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/p-1/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1
SMILES[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of cholate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:cholate Cholate
chebi:11895
chebi:13978
chebi:20216
chebi:23168
chebi:29747
chebi:57748
3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oate
3alpha,7alpha,12alpha-trihydroxy-5beta-cholanate
BHQCQFFYRZLCQQ-OELDTZBJSA-M
cholate
chebi:16359
chebi:1694
chebi:20223
chebi:23210
chebi:29077
chebi:41494
(3alpha,5beta,7alpha,12alpha)-3,7,12-trihydroxycholan-24-oic acid
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanate
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanic acid
3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oic acid
3alpha,7alpha,12alpha-trihydroxy-5beta-cholanic acid
BHQCQFFYRZLCQQ-OELDTZBJSA-N
CHOLIC ACID
Cholic acid
Cholsaeure
cholic acid
hmdb:HMDB00619 (4R)-4-[(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-5,9,16-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]pentanoic acid
Cholic acid
cholic acid
kegg:C00695
kegg:D10699
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanate
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanic acid
Cholate
Cholbam (TN)
Cholic acid
Cholic acid (USAN)
lipidmaps:LMST04010001 3Alpha,7Alpha,12Alpha-trihydroxy-5Beta-cholan-24-oic acid
Cholic Acid
Cholic acid
lipidmaps:LMST04010001
metacyc:CHOLATE 3alpha,7alpha,12alpha-trihydroxy-5beta-cholan-24-oate
CHOLATE
cholate
cholic acid
reactome:193451 cholate
cholic acid
sabiork:5188
seed:cpd00526
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanate
3alpha,7alpha,12alpha-Trihydroxy-5beta-cholanic acid
Cholate
Cholic acid
slm:000000859 cholate