My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

butanoate

Image of MNXM458
Properties
MNX_IDMNXM458
formulaC4H7O2
charge-1
mass87.0977
referencechebi:17968
InChIKeyFERIUCNNQQJTOY-UHFFFAOYSA-M
InChIInChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1
SMILESCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of butanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:113450
chebi:22948
chebi:30772
chebi:3234
chebi:41208
1-butanoic acid
1-butyric acid
1-propanecarboxylic acid
4:0
BUTANOIC ACID
Butanoate
Butanoic acid
Buttersaeure
Butyric acid
C4:0
CH3-[CH2]2-COOH
FERIUCNNQQJTOY-UHFFFAOYSA-N
acide butanoique
acide butyrique
butanic acid
butanoic acid
butoic acid
butyric acid
ethylacetic acid
n-butanoic acid
n-butyric acid
propanecarboxylic acid
propylformic acid
chebi:13924
chebi:17968
chebi:22946
1-butanoate
1-butyrate
1-propanecarboxylate
CH3-[CH2]2-COO(-)
FERIUCNNQQJTOY-UHFFFAOYSA-M
butanate
butanoate
butanoic acid, ion(1-)
butyrate
n-butanoate
n-butyrate
propanecarboxylate
propylformate
envipath:...eca131ec9c03 Butyrate
envipath:...d822f151565f compound 38024
hmdb:HMDB00039 Butyric acid
butanoic acid
butyric acid
lipidmaps:LMFA01010004 Butanoate
Butanoic acid
Butyric acid
C4:0
lipidmaps:LMFA01010004
metacyc:BUTYRIC_ACID 1-propanecarboxylic acid
BUTYRIC_ACID
butanoate
butanoic acid
butyrate
butyric acid
ethylacetic acid
n-butanoate
propylformic acid
reactome:76179
reactome:8875042
BUT
Butyrate
butyric acid
kegg:C00246
sabiork:1911
Butanoate
Butanoic acid
Butyrate
Butyric acid
seed:cpd00211 Butanoate
Butanoic acid
Butyrate
Butyrate (n-C4,0)
Butyric acid
M_Butyrate
but
slm:000001195 Butanoate
butyrate