My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

maleylacetate

Image of MNXM472
Properties
MNX_IDMNXM472
formulaC6H4O5
charge-2
mass156.0941
referencechebi:16468
InChIKeySOXXPQLIZIPMIZ-UPHRSURJSA-L
InChIInChI=1S/C6H6O5/c7-4(3-6(10)11)1-2-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1-
SMILES[O-]C(=O)CC(=O)C=CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of maleylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:1184 (2Z)-4-oxohex-2-enedioic acid
(Z)-4-oxo-2-hexenedioic acid
2-Maleylacetate
4-Oxohex-2-enedioate
Maleylacetate
SOXXPQLIZIPMIZ-UPHRSURJSA-N
maleylacetic acid
chebi:11821
chebi:1533
chebi:17419
chebi:20058
(2E,4Z)-3-hydroxyhexa-2,4-dienedioic acid
3-Hydroxy-cis,cis-muconate
3-hydroxy-cis,cis-muconate
3-hydroxy-cis,cis-muconic acid
DLKZGMNZEDNHKO-BXTBVDPRSA-N
chebi:11607
chebi:14561
chebi:16468
chebi:19671
(2Z)-4-oxohex-2-enedioate
SOXXPQLIZIPMIZ-UPHRSURJSA-L
maleylacetate
chebi:58139 (2E,4Z)-3-hydroxyhexa-2,4-dienedioate
3-hydroxy-cis,cis-muconate
3-hydroxy-cis,cis-muconate dianion
3-hydroxy-cis,cis-muconate(2-)
DLKZGMNZEDNHKO-BXTBVDPRSA-L
envipath:...d817336c6045 Maleylacetate
envipath:...130add0c27cd compound 42082
envipath:...aab1dde0270d compound 42274
envipath:...ed503e334308
envipath:...2f4294e52ef0
compound 42284
hmdb:HMDB60348 (2Z)-4-oxohex-2-enedioic acid
2-Maleylacetate
maleylacetic acid
kegg:C03676
seed:cpd02307
3-Hydroxy-cis,cis-muconate
lipidmaps:LMFA01170071 3-Hydroxy-cis,cis-muconate
3-hydroxy-2E,4E-hexadienedioic acid
3-hydroxy-cis,cis-muconate
3-hydroxy-cis,cis-muconic acid
lipidmaps:LMFA01170071
metacyc:3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE
3-hydroxy-cis,cis-muconate
metacyc:CPD-294 (2Z)-4-oxohex-2-enedioate
2-maleylacetate
4-oxohex-2-enedioate
CPD-294
maleylacetate
kegg:C02222
sabiork:2384
seed:cpd01498
2-Maleylacetate
4-Oxohex-2-enedioate
Maleylacetate
seed:cpd29434 2-maleylacetate
4-oxohex-2-enedioate
maleylacetate
deprecated:MNXM114170
deprecated:MNXM90331