Feedback

 

L-quinate

Image of MNXM474
Properties
MNX_IDMNXM474
formulaC7H11O6
charge-1
mass191.1592
referencechebi:29751
InChIKeyAAWZDTNXLSGCEK-WYWMIBKRSA-M
InChIInChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/p-1/t3-,4-,5-,7+/m1/s1
SMILESO[C@@H]1C[C@@](O)(C[C@@H](O)[C@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-quinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:quin Quinate
chebi:15000
chebi:26489
chebi:29751
(-)-quinate
(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
1L-1(OH),3,4/5-Tetrahydroxycyclohexanecarboxylate
AAWZDTNXLSGCEK-WYWMIBKRSA-M
L-quinate
Quinate
chebi:17521
chebi:26492
chebi:8715
(-)-Quinic acid
(-)-quinic acid
(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylic acid
1L-1(OH),3,4/5-tetrahydroxycyclohexanecarboxylic acid
AAWZDTNXLSGCEK-WYWMIBKRSA-N
Chinic acid
D-Quinic acid
Kinic acid
L-Quinic acid
Quinic acid
kegg:C00296 (-)-Quinic acid
Chinic acid
Kinic acid
L-Quinate
L-Quinic acid
Quinate
Quinic acid
metacyc:QUINATE (-)-quinate
(-)-quinic acid
(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
L-quinate
QUINATE
sabiork:27312 (-)-Quinate
sabiork:5034 Chinic acid
Kinic acid
L-Quinate
L-Quinic acid
Quinate
Quinic acid
seed:cpd00248 (-)-Quinic acid
Chinic acid
Kinic acid
L-Quinate
L-Quinic acid
Quinate
Quinic acid
quin-kt