Feedback

 

malonate

Image of MNXM477
Properties
MNX_IDMNXM477
formulaC3H2O4
charge-2
mass102.0467
referencechebi:15792
InChIKeyOFOBLEOULBTSOW-UHFFFAOYSA-L
InChIInChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/p-2
SMILES[O-]C(=O)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of malonate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:malon Malonate
chebi:14563
chebi:15792
chebi:25130
chebi:44151
(-)OOC-CH2-COO(-)
MALONATE ION
OFOBLEOULBTSOW-UHFFFAOYSA-L
malo
malonate
malonate(2-)
malonic acid, ion(2-)
propanedioate
propanedioic acid, ion(2-)
chebi:25132
chebi:30794
chebi:44060
chebi:6660
H2malo
HOOC-CH2-COOH
MALONIC ACID
Malonic acid
OFOBLEOULBTSOW-UHFFFAOYSA-N
Propanedioic acid
malonic acid
propanedioic acid
chebi:30795 HOOC-CH2-COO(-)
Hmalo
Malonic acid, conjugate base
OFOBLEOULBTSOW-UHFFFAOYSA-M
carboxyacetate
malonate(1-)
envipath:...582e929c9ac5 compound 604
envipath:...f9cbbecb6e00 compound 37993
hmdb:HMDB00691 Malonic acid
malonic acid
propanedioic acid
kegg:C00383
sabiork:2035
Malonate
Malonic acid
Propanedioic acid
lipidmaps:LMFA01170041 Malonic acid
Propanedioic acid
lipidmaps:LMFA01170041
metacyc:MALONATE MALONATE
malonate
malonic acid
malonyl
propanedioic acid
seed:cpd00308 Malonate
Malonic acid
Propanedioic acid
maln
seed:cpd12000 Dicarboxylate
Dicarboxylic acid
seed:cpd12448 alpha,omega-Dicarboxylic acid
deprecated:MNXM93344