Feedback

 

3-dehydroquinate

Image of MNXM478
Properties
MNX_IDMNXM478
formulaC7H9O6
charge-1
mass189.1433
referencechebi:32364
InChIKeyWVMWZWGZRAXUBK-SYTVJDICSA-M
InChIInChI=1S/C7H10O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3,5,8,10,13H,1-2H2,(H,11,12)/p-1/t3-,5+,7-/m1/s1
SMILESO[C@@H]1C[C@@](O)(CC(=O)[C@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-dehydroquinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3dhq 3-Dehydroquinate
chebi:11781
chebi:12122
chebi:32364
3-Dehydroquinate
3-dehydroquinate
5-Dehydroquinate
WVMWZWGZRAXUBK-SYTVJDICSA-M
rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate
chebi:1487
chebi:17947
chebi:19997
chebi:42078
3-Dehydroquinic acid
3-dehydroquinic acid
5-Dehydroquinic acid
WVMWZWGZRAXUBK-SYTVJDICSA-N
rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylic acid
hmdb:HMDB12710 (1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylic acid
3-Dehydroquinate
3-dehydroquinic acid
metacyc:DEHYDROQUINATE 3-dehydroquinate
3-dehydroquinic acid
5-de-H-quinate
5-dehydroquinate
5-dehydroquinic acid
DEHYDROQUINATE
rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate
reactome:964921 3-dehydroquinate
3DHQ
sabiork:27311 (-)-3-Dehydroquinate
kegg:C00944
sabiork:5328
3-Dehydroquinate
3-Dehydroquinic acid
5-Dehydroquinate
5-Dehydroquinic acid
seed:cpd00699 3-Dehydroquinate
3-Dehydroquinic acid
3dhq
5-Dehydroquinate
5-Dehydroquinic acid
deprecated:MNXM91945