Feedback

 

(S)-2,3,4,5-tetrahydrodipicolinate

Image of MNXM480
Properties
MNX_IDMNXM480
formulaC7H7NO4
charge-2
mass169.1359
referencechebi:16845
InChIKeyCXMBCXQHOXUCEO-BYPYZUCNSA-L
InChIInChI=1S/C7H9NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCCC(=N1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-2,3,4,5-tetrahydrodipicolinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:thdp 2,3,4,5-Tetrahydrodipicolinate
chebi:11408 2,3,4,5-tetrahydrodipicolinate
2,3,4,5-tetrahydrodipicolinate(2-)
2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
CXMBCXQHOXUCEO-UHFFFAOYSA-L
chebi:13042
chebi:16845
chebi:18055
chebi:21189
chebi:6152
(2S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
(S)-2,3,4,5-Tetrahydropyridine-2,6-dicarboxylate
(S)-2,3,4,5-tetrahydrodipicolinate
(S)-2,3,4,5-tetrahydrodipicolinate(2-)
(S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
CXMBCXQHOXUCEO-BYPYZUCNSA-L
L-2,3,4,5-Tetrahydrodipicolinate
chebi:32976 2,3,4,5-tetrahydro-2,6-pyridinedicarboxylic acid
2,3,4,5-tetrahydrodipicolinic acid
2,3,4,5-tetrahydropyridine-2,6-dicarboxylic acid
CXMBCXQHOXUCEO-UHFFFAOYSA-N
THDPA
chebi:864 (2S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylic acid
(S)-2,3,4,5-tetrahydrodipicolinic acid
CXMBCXQHOXUCEO-BYPYZUCNSA-N
L-2,3,4,5-tetrahydrodipicolinic acid
hmdb:HMDB12289 2,3,4,5-tetrahydropyridine-2,6-dicarboxylic acid
Tetrahydrodipicolinate
thdpa
kegg:C03972 (S)-2,3,4,5-Tetrahydropyridine-2,6-dicarboxylate
2,3,4,5-Tetrahydrodipicolinate
Delta1-Piperidine-2,6-dicarboxylate
L-2,3,4,5-Tetrahydrodipicolinate
metacyc:DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE (S)-2,3,4,5-tetrahydrodipicolinate
(S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
2,3,4,5-tetrahydrodipicolinate
DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE
L-2,3,4,5-tetrahydrodipicolinate
delta1-piperideine-2,6-dicarboxylate
tetrahydrodipicolinate
tetrahydropyridine-2,6-dicarboxylate
sabiork:6990 (S)-2,3,4,5-Tetrahydropyridine-2,6-dicarboxylate
2,3,4,5-Tetrahydrodipicolinate
L-2,3,4,5-Tetrahydrodipicolinate
delta1-Piperidine-2,6-dicarboxylate
seed:cpd02465 (S)-2,3,4,5-Tetrahydropyridine-2,6-dicarboxylate
2,3,4,5-Tetrahydrodipicolinate
2-3-4-5-Tetrahydrodipicolinate
L-2,3,4,5-Tetrahydrodipicolinate
delta1-Piperidine-2,6-dicarboxylate
tetrahydrodipicolinate
thdp
seed:cpd29199 2,3,4,5-Tetrahydrodipicolinate
L-2,3,4,5-tetrahydrodipicolinate
delta1-piperideine-2,6-dicarboxylate
tetrahydrodipicolinate