Feedback

 

3-sulfino-L-alanine

Image of MNXM498
Properties
MNX_IDMNXM498
formulaC3H6NO4S
charge-1
mass152.15
referencechebi:61085
InChIKeyADVPTQAUNPRNPO-REOHCLBHSA-M
InChIInChI=1S/C3H7NO4S/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/p-1/t2-/m0/s1
SMILES[NH3+][C@@H](CS([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-sulfino-L-alanine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3sala 3-Sulfino-L-alanine
chebi:11888
chebi:11889
chebi:16345
chebi:1664
chebi:21271
chebi:41618
chebi:8973
(2R)-2-amino-3-sulfinopropanoic acid
3-SULFINOALANINE
3-Sulfino-L-alanine
3-Sulfinoalanine
3-Sulphino-L-alanine
3-sulfino-L-alanine
ADVPTQAUNPRNPO-REOHCLBHSA-N
L-Cysteinesulfinic acid
chebi:224037 (2R)-2-amino-3-sulfinatopropanoate
3-sulfinato-L-alaninate
3-sulfinato-L-alaninate dianion
3-sulfinato-L-alaninate(2-)
ADVPTQAUNPRNPO-REOHCLBHSA-L
chebi:41721 2-amino-3-sulfino-propionic acid
3-(dioxido-lambda(6)-sulfanyl)-L-alanine
L-cysteine-S,S-dioxide
L-cysteine-S-dioxide
WVMUCBHSEHBMKA-REOHCLBHSA-N
cysteine-S,S-dioxide
cysteine-S-dioxide
chebi:61085 (2R)-2-ammonio-3-sulfinatopropanoate
(2R)-2-azaniumyl-3-sulfinatopropanoate
3-sulfino-L-alanine
3-sulfino-L-alanine(1-)
ADVPTQAUNPRNPO-REOHCLBHSA-M
L-cysteine sulfinate
cysteine sulfinate
cysteine sulfinic acid(1-)
cysteinesulfinate
envipath:...0d8d56942369 compound 39764
hmdb:HMDB00996 (2R)-2-amino-3-sulfonylpropanoic acid
3-Sulfinoalanine
cysteine-S-dioxide
kegg:C00606
sabiork:5155
3-Sulfino-L-alanine
3-Sulfinoalanine
3-Sulphino-L-alanine
L-Cysteinesulfinic acid
metacyc:3-SULFINOALANINE 3-SULFINOALANINE
3-sulfino-L-alanine
3-sulfinoalanine
3-sulphino-L-alanine
L-cysteine sulfinate
L-cysteinesulfinic acid
cysteine sulfinate
cysteine sulphinate
cysteine-sulfinate
reactome:1614519 3-Sulfinoalanine
3-sulfino-L-alanine
seed:cpd00467 3-Sulfino-L-alanine
3-Sulfinoalanine
3-Sulphino-L-alanine
3sala
L-Cysteinesulfinic acid
deprecated:MNXM59359
deprecated:MNXM90045
deprecated:MNXM90679