Feedback

 

3-phosphonooxypyruvate

Image of MNXM541
Properties
MNX_IDMNXM541
formulaC3H2O7P
charge-3
mass181.0192
referencechebi:18110
InChIKeyLFLUCDOSQPJJBE-UHFFFAOYSA-K
InChIInChI=1S/C3H5O7P/c4-2(3(5)6)1-10-11(7,8)9/h1H2,(H,5,6)(H2,7,8,9)/p-3
SMILES[O-]C(=O)C(=O)COP([O-])([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-phosphonooxypyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3php 3-Phosphohydroxypyruvate
chebi:11883
chebi:11884
chebi:18110
chebi:20191
2-oxo-3-(phosphonatooxy)propanoate
3-Phosphohydroxypyruvate
3-Phosphonooxypyruvate
3-phosphonatooxypyruvate(3-)
3-phosphonooxypyruvate
LFLUCDOSQPJJBE-UHFFFAOYSA-K
phosphohydroxypyruvate
chebi:1661
chebi:20192
chebi:30933
2-oxo-3-(phosphonooxy)propanoic acid
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvic acid
3-phosphonooxypyruvic acid
Hydroxypyruvic acid phosphate
LFLUCDOSQPJJBE-UHFFFAOYSA-N
phosphohydroxypyruvic acid
metacyc:3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE
3-P-hydroxypyruvate
3-p-OH-pyr
3-p-OH-pyruvate
3-p-hydroxy-pyr
3-phospho-hydroxypyruvate
3-phosphohydroxy-pyr
3-phosphohydroxypyruvate
3-phosphonooxypyruvate
phosphohydroxypyruate
phosphohydroxypyruvate
reactome:977329 3-phosphonooxypyruvic acid
3POPA
kegg:C03232
sabiork:2712
3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvate
3-Phosphonooxypyruvic acid
seed:cpd02069 3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvate
3-Phosphonooxypyruvic acid
3-phospho-hydroxypyruvate
3php
deprecated:MNXM89846
deprecated:MNXM91974