Feedback

 

allantoate

Image of MNXM584
Properties
MNX_IDMNXM584
formulaC4H7N4O4
charge-1
mass175.1233
referencechebi:17536
InChIKeyNUCLJNSWZCHRKL-UHFFFAOYSA-M
InChIInChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12)/p-1
SMILESNC(=O)NC(NC(N)=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of allantoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:alltt Allantoate
chebi:13760
chebi:17536
chebi:22352
NUCLJNSWZCHRKL-UHFFFAOYSA-M
allantoate
bis(carbamoylamino)acetate
bis[(aminocarbonyl)amino]acetate
diureidoacetate
chebi:22353
chebi:2593
chebi:30837
Allantoic acid
NUCLJNSWZCHRKL-UHFFFAOYSA-N
allantoic acid
bis(carbamoylamino)acetic acid
bis[(aminocarbonyl)amino]acetic acid
diureidoacetic acid
hmdb:HMDB01209 2,2-bis(carbamoylamino)acetic acid
Allantoic acid
allantoic acid
metacyc:ALLANTOATE ALLANTOATE
allantoate
allantoic acid
kegg:C00499
sabiork:1873
Allantoate
Allantoic acid
seed:cpd00388 Allantoate
Allantoic acid
alltt