Feedback

 

LL-2,6-diaminopimelate

Image of MNXM644
Properties
MNX_IDMNXM644
formulaC7H14N2O4
charge0
mass190.1971
referencechebi:57609
InChIKeyGMKMEZVLHJARHF-WHFBIAKZSA-N
InChIInChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1
SMILES[NH3+][C@@H](CCC[C@H]([NH3+])C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of LL-2,6-diaminopimelate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:26dap_LL LL-2,6-Diaminoheptanedioate
chebi:13192
chebi:21428
chebi:47031
(2S,6S)-2,6-diaminoheptanedioate
(S,S)-2,6-diaminopimelate(2-)
GMKMEZVLHJARHF-WHFBIAKZSA-L
LL-2,6-diaminoheptanedioate
LL-2,6-diaminopimelate
LL-2,6-diaminopimelate(2-)
chebi:16026
chebi:21429
chebi:6341
(2S,6S)-2,6-diaminoheptanedioic acid
(S,S)-2,6-diaminopimelic acid
(S-(R*,R*))-2,6-diaminoheptanedioic acid
GMKMEZVLHJARHF-WHFBIAKZSA-N
L,L-2,6-diaminopimelic acid
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
LL-2,6-diaminopimelic acid
chebi:57609 (2S,6S)-2,6-diaminopimelic acid dizwitterion
(2S,6S)-2,6-diammonioheptanedioate
(2S,6S)-2,6-diazaniumylheptanedioate
(S,S)-2,6-diaminopimelic acid dizwitterion
GMKMEZVLHJARHF-WHFBIAKZSA-N
L,L-2,6-diaminopimelic acid dizwitterion
LL-2,6-diaminopimelate
LL-2,6-diaminopimelic acid dizwitterion
hmdb:HMDB01370 (2S,6S)-2,6-diaminoheptanedioic acid
Diaminopimelic acid
diamino-pimelic acid
lipidmaps:LMFA01170102 2,6-diamino-heptanedioic acid
diamino-pimelic acid
lipidmaps:LMFA01170102
metacyc:LL-DIAMINOPIMELATE L,L-2,6-diaminoheptanedioate
L,L-2,6-diaminopimelate
L,L-A2pm
L,L-DAP
L,L-diaminopimelate
LL-DIAMINOPIMELATE
kegg:C00666
sabiork:5171
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
seed:cpd00504 26dap-LL
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
LL-2-6-Diaminoheptanedioate