Feedback

 

phosphoenolpyruvate

Image of MNXM73
Properties
MNX_IDMNXM73
formulaC3H2O6P
charge-3
mass165.0198
referencechebi:58702
InChIKeyDTBNBXWJWCWCIK-UHFFFAOYSA-K
InChIInChI=1S/C3H5O6P/c1-2(3(4)5)9-10(6,7)8/h1H2,(H,4,5)(H2,6,7,8)/p-3
SMILES[O-]C(=O)C(=C)OP([O-])([O-])=O

This chemical compound does not exist in my selection



Occurrences of phosphoenolpyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:pep Phosphoenolpyruvate
chebi:26055
chebi:44894
chebi:44897
2-(phosphonooxy)-2-propenoic acid
2-(phosphonooxy)prop-2-enoic acid
2-PHOSPHOENOLPYRUVIC ACID
DTBNBXWJWCWCIK-UHFFFAOYSA-N
PEP
PHOSPHOENOLPYRUVATE
Phosphoenolpyruvic acid
phosphoenolpyruvic acid
chebi:58702 2-(phosphonoatooxy)prop-2-enoate
DTBNBXWJWCWCIK-UHFFFAOYSA-K
phosphoenolpyruvate
phosphonatoenolpyruvate
phosphonatoenolpyruvate(3-)
chebi:14812
chebi:18021
chebi:26054
chebi:8147
2-(phosphonooxy)-2-propenoate
2-(phosphonooxy)acrylate
2-(phosphonooxy)prop-2-enoate
2-hydroxy-2-propenoate (dihydrogen phosphate) (ester)
2-hydroxy-2-propenoate phosphate (ester)
DTBNBXWJWCWCIK-UHFFFAOYSA-M
O-phosphono-enol-pyruvate
PEP
PHOSPHOENOLPYRUVATE
Phosphoenolpyruvate
phosphoenolpyruvate
phosphoenolpyruvate(1-)
hmdb:HMDB00263 2-(phosphonooxy)prop-2-enoic acid
Phosphoenolpyruvic acid
phosphoenolpyruvic acid
kegg:C00074 PEP
Phosphoenolpyruvate
Phosphoenolpyruvic acid
metacyc:PHOSPHO-ENOL-PYRUVATE 2-(phosphonooxy)- 2-propenoate
PEP
PHOSPHO-ENOL-PYRUVATE
phosphoenolpyruvate
reactome:29492
reactome:372364
PEP
Phosphoenolpyruvic acid
phosphoenolpyruvate
sabiork:32 2-Phosphoenolpyruvate
PEP
Phosphoenolpyruvate
Phosphoenolpyruvic acid
seed:cpd00061 PEP
Phosphoenolpyruvate
Phosphoenolpyruvic acid
pep
deprecated:MNXM89641
deprecated:MNXM89671