Feedback

 

N-acetyl-L-glutamate(2-)

Image of MNXM730
Properties
MNX_IDMNXM730
formulaC7H9NO5
charge-2
mass187.1512
referencechebi:44337
InChIKeyRFMMMVDNIPUKGG-YFKPBYRVSA-L
InChIInChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t5-/m0/s1
SMILESCC(=O)N[C@@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-acetyl-L-glutamate(2-) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:acglu N-Acetyl-L-glutamate
chebi:17533
chebi:21552
chebi:44335
chebi:7150
(2S)-2-acetamidopentanedioic acid
(S)-2-(acetylamino)pentanedioic acid
Ac-Glu-OH
Acetyl-L-glutamic acid
Acetylglutamic acid
L-N-acetylglutamic acid
N-ACETYL-L-GLUTAMATE
N-Ac-Glu-OH
N-Acetyl-L-glutamic acid
N-Acetylglutamic acid
N-acetyl-L-glutamic acid
RFMMMVDNIPUKGG-YFKPBYRVSA-N
acetylglutamic acid
chebi:21549 (2S)-2-(acetylammonio)pentanedioate
N-acetyl-L-glutamate(1-)
RFMMMVDNIPUKGG-YFKPBYRVSA-M
chebi:12575
chebi:44337
chebi:64040
chebi:87274
(2S)-2-acetamidopentanedioate
(S)-2-(acetylamino)pentanedioate
N-Acetyl-L-glutamate
N-acetyl-L-glutamate(2-)
NAG
RFMMMVDNIPUKGG-YFKPBYRVSA-L
acetyl-L-glutamate
kegg:C00624
sabiork:2120
N-Acetyl-L-glutamate
N-Acetyl-L-glutamic acid
metacyc:ACETYL-GLU ACETYL-GLU
N-acetyl-L-glutamate
N-acetyl-L-glutamic acid
NAG
acetyl-L-glu
acetyl-L-glutamate
reactome:30471 N-Acetyl-L-glutamate
N-acetyl-L-glutamic acid
NAcGlu
seed:cpd00477 N-Acetyl-L-glutamate
N-Acetyl-L-glutamic acid
acglu
deprecated:MNXM90479