My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

L-tyrosine

Image of MNXM76
Properties
MNX_IDMNXM76
formulaC9H11NO3
charge0
mass181.1885
referencechebi:58315
InChIKeyOUYCCCASQSFEME-QMMMGPOBSA-N
InChIInChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
SMILES[NH3+][C@@H](Cc1ccc(O)cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-tyrosine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:15277
chebi:18186
chebi:27176
chebi:9800
2-Amino-3-(p-hydroxyphenyl)propionic acid
2-amino-3-(4-hydroxyphenyl)propanoic acid
3-(p-Hydroxyphenyl)alanine
OUYCCCASQSFEME-UHFFFAOYSA-N
Tyr
Tyrosin
Tyrosine
Y
tirosina
tyrosine
chebi:32760 (2S)-2-amino-3-(4-hydroxyphenyl)propanoate
L-tyrosinate(1-)
L-tyrosine anion
L-tyrosine monoanion
OUYCCCASQSFEME-QMMMGPOBSA-M
hydrogen L-tyrosinate
chebi:32761 (2S)-2-amino-3-(4-oxidophenyl)propanoate
L-tyrosinate
L-tyrosinate(2-)
L-tyrosine dianion
OUYCCCASQSFEME-QMMMGPOBSA-L
chebi:32762 (1S)-1-carboxy-2-(4-hydroxyphenyl)ethanaminium
L-tyrosine cation
L-tyrosinium
OUYCCCASQSFEME-QMMMGPOBSA-O
chebi:32784 2-amino-3-(4-hydroxyphenyl)propanoate
OUYCCCASQSFEME-UHFFFAOYSA-M
hydrogen tyrosinate
tyrosinate(1-)
tyrosine anion
chebi:32785 2-amino-3-(4-oxidophenyl)propanoate
OUYCCCASQSFEME-UHFFFAOYSA-L
tyrosinate
tyrosinate(2-)
tyrosine dianion
chebi:32786 1-carboxy-2-(4-hydroxyphenyl)ethanaminium
OUYCCCASQSFEME-UHFFFAOYSA-O
tyrosine cation
tyrosinium
chebi:13181
chebi:17895
chebi:21411
chebi:46070
chebi:46161
chebi:6313
(-)-alpha-amino-p-hydroxyhydrocinnamic acid
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
(S)-(-)-Tyrosine
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
(S)-Tyrosine
(S)-alpha-amino-4-hydroxybenzenepropanoic acid
4-hydroxy-L-phenylalanine
L-Tyrosin
L-Tyrosine
L-tyrosine
OUYCCCASQSFEME-QMMMGPOBSA-N
TYROSINE
Tyr
Tyrosine
Y
chebi:58315 (2S)-2-ammonio-3-(4-hydroxyphenyl)propanoate
(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate
L-tyrosine
L-tyrosine zwitterion
OUYCCCASQSFEME-QMMMGPOBSA-N
bigg:tyr__L
envipath:...6bd3196c0365
L-Tyrosine
hmdb:HMDB00158
hmdb:HMDB00647
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
L-Tyrosine
L-tyrosine
kegg:C00082
kegg:D00022
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
L-Tyrosine
L-Tyrosine (JP17)
Tyrosine
Tyrosine (USP/INN)
metacyc:TYR L-tyr
L-tyrosine
TYR
Y
tyr
tyrosine
reactome:29506
reactome:352030
reactome:379710
reactome:5668567
(S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
L-Tyr
L-tyrosine
L-tyrosine zwitterion
kegg:C01536
sabiork:2291
2-Amino-3-(p-hydroxyphenyl)propionic acid
3-(p-Hydroxyphenyl)alanine
Tyrosine
sabiork:84 (S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
L-Tyrosine
Tyr
seed:cpd00069 (S)-2-Amino-3-(p-hydroxyphenyl)propionic acid
(S)-3-(p-Hydroxyphenyl)alanine
2-Amino-3-(p-hydroxyphenyl)propionic acid
3-(p-Hydroxyphenyl)alanine
DL-Tyrosine
L-Tyrosine
Tyrosine
tyr-L
seed:cpd30745 2-Amino-3-(p-hydroxyphenyl)propionic acid
3-(p-Hydroxyphenyl)alanine
DL-Tyrosine
deprecated:MNXM88389
deprecated:MNXM96426