My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

3-hydroxypropanoate

Image of MNXM872
Properties
MNX_IDMNXM872
formulaC3H5O3
charge-1
mass89.0705
referencechebi:16510
InChIKeyALRHLSYJTWAHJZ-UHFFFAOYSA-M
InChIInChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6)/p-1
SMILESOCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of 3-hydroxypropanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hpp 3-Hydroxypropanoate
chebi:1553
chebi:20071
chebi:33404
chebi:40000
3-HYDROXY-PROPANOIC ACID
3-Hydroxypropanoic acid
3-Hydroxypropionic acid
3-hydroxypropanoic acid
3-hydroxypropionic acid
ALRHLSYJTWAHJZ-UHFFFAOYSA-N
Hydracrylic acid
beta-hydroxypropionic acid
chebi:11836
chebi:16510
chebi:20079
3-Hydroxypropionate
3-hydroxypropanoate
3-hydroxypropionate
ALRHLSYJTWAHJZ-UHFFFAOYSA-M
beta-hydroxypropionate
envipath:...80f89844ef72 compound 44009
metacyc:3-HYDROXY-PROPIONATE 3-HYDROXY-PROPIONATE
3-hydropropionic acid
3-hydroxypropanoate
3-hydroxypropanoic acid
3-hydroxypropionate
beta-hydroxypropionate
hydracrylic acid
kegg:C01013
sabiork:2214
seed:cpd00745
3-Hydroxypropanoate
3-Hydroxypropanoic acid
3-Hydroxypropionate
3-Hydroxypropionic acid
Hydracrylic acid
deprecated:MNXM90914