Feedback

 

(2R,3S)-3-isopropylmalate

Image of MNXM891
Properties
MNX_IDMNXM891
formulaC7H10O5
charge-2
mass174.1524
referencechebi:35121
InChIKeyRNQHMTFBUSSBJQ-CRCLSJGQSA-L
InChIInChI=1S/C7H12O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-5,8H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-,5+/m0/s1
SMILESCC(C)[C@@H]([C@@H](O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2R,3S)-3-isopropylmalate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3c2hmp 3-Carboxy-2-hydroxy-4-methylpentanoate
chebi:11760
chebi:11843
chebi:15592
chebi:20094
2-hydroxy-3-(propan-2-yl)butanedioate
2-hydroxy-3-isopropylsuccinate
3-isopropylmalate(2-)
RNQHMTFBUSSBJQ-UHFFFAOYSA-L
chebi:35114 2-hydroxy-3-(propan-2-yl)butanedioic acid
2-hydroxy-3-isopropylsuccinic acid
3-carboxy-2-hydroxy-4-methylpentanoic acid
3-isopropylmalic acid
RNQHMTFBUSSBJQ-UHFFFAOYSA-N
chebi:1565
chebi:35120
chebi:35121
(2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioate
(2R,3S)-2-hydroxy-3-isopropylsuccinate
(2R,3S)-3-Isopropylmalate
(2R,3S)-3-isopropylmalate
(2R,3S)-3-isopropylmalate(2-)
2-D-threo-Hydroxy-3-carboxy-isocaproate
RNQHMTFBUSSBJQ-CRCLSJGQSA-L
chebi:35122
chebi:43465
chebi:43468
(2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioic acid
(2R,3S)-2-hydroxy-3-isopropylsuccinic acid
(2R,3S)-3-carboxy-2-hydroxy-4-methylpentanoic acid
(2R,3S)-3-isopropylmalic acid
2-D-threo-Hydroxy-3-carboxy-isocaproate
2-D-threo-hydroxy-3-carboxyisocaproic acid
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
RNQHMTFBUSSBJQ-CRCLSJGQSA-N
hmdb:HMDB12156 (2R,3S)-2-hydroxy-3-(propan-2-yl)butanedioic acid
(2R,3S)-3-isopropylmalic acid
3-Isopropylmalate
kegg:C04411 (2R,3S)-3-Isopropylmalate
2-D-threo-Hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
metacyc:2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE (2R,3S)-3-isopropylmalate
2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE
2-D-threo-hydroxy-3-carboxy-isocaproate
3-carboxy-2-hydroxy-4-methylpentanoate
3-isopropylmalate
beta-isopropylmalate
sabiork:7292 2-D-threo-Hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
seed:cpd02693 (2R,3S)-3-Isopropylmalate
2-D-threo-Hydroxy-3-carboxy-isocaproate
3-Carboxy-2-hydroxy-4-methylpentanoate
3-Isopropylmalate
3c2hmp
deprecated:MNXM6092