My Selection

Analyze

Create / Modify

Utilities

Documents

About

ETHZ logo SIB logo EPFL logo
 Feedback

 

(S)-2,3-diaminopropanoate

Image of MNXM91374
Properties
MNX_IDMNXM91374
formulaC3H8N2O2
charge0
mass104.1078
referencechebi:57721
InChIKeyPECYZEOJVXMISF-REOHCLBHSA-N
InChIInChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m0/s1
SMILESN[C@@H](C[NH3+])C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-2,3-diaminopropanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:23dappa 2,3-diaminopropionate
chebi:11419
chebi:18383
chebi:19309
chebi:876
2,3-Diaminopropanoate
2,3-Diaminopropanoic acid
2,3-Diaminopropionate
2,3-Diaminopropionic acid
2,3-diaminopropanoic acid
2,3-diaminopropionic acid
3-aminoalanine
Dap
Dpr
PECYZEOJVXMISF-UHFFFAOYSA-N
chebi:13043 (2S)-2,3-diaminopropanoate
3-amino-L-alaninate
PECYZEOJVXMISF-REOHCLBHSA-M
chebi:16303
chebi:21190
chebi:42159
chebi:6153
(2S)-2,3-diaminopropanoic acid
3-amino-L-alanine
Dpr
L-2,3-Diaminopropanoate
L-2,3-Diaminopropanoic acid
L-2,3-Diaminopropionate
L-2,3-Diaminopropionic acid
PECYZEOJVXMISF-REOHCLBHSA-N
chebi:42164 3-AMINO-ALANINE
3-ammonio-L-alanine
PECYZEOJVXMISF-REOHCLBHSA-O
chebi:49983 2,3-diaminopropanoate
3-aminoalaninate
PECYZEOJVXMISF-UHFFFAOYSA-M
chebi:57721 (2S)-2,3-diaminopropanoate
(2S)-2-amino-3-ammoniopropanoate
(2S)-2-amino-3-azaniumylpropanoate
(S)-2,3-diaminopropanoate
3-amino-L-alanine zwitterion
PECYZEOJVXMISF-REOHCLBHSA-N
chebi:58468 2,3-diaminopropanoate
2-amino-3-ammoniopropanoate
3-aminoalanine zwitterion
PECYZEOJVXMISF-UHFFFAOYSA-N
chebi:84374 (2S)-2,3-diammoniopropanoate
(2S)-2,3-diazaniumylpropanoate
(S)-2,3-diaminopropanoate(1+)
3-ammonio-L-alanine(1+)
PECYZEOJVXMISF-REOHCLBHSA-O
hmdb:HMDB02006 (2S)-2,3-diaminopropanoic acid
2,3-Diaminopropionic acid
L-2,3-diaminopropionic acid
kegg:C03401 (S)-2,3-Diaminopropanoate
3-Amino-L-alanine
L-2,3-Diaminopropanoate
L-2,3-Diaminopropanoic acid
L-2,3-Diaminopropionate
L-2,3-Diaminopropionic acid
kegg:C06393
sabiork:8608
2,3-Diaminopropanoate
2,3-Diaminopropanoic acid
2,3-Diaminopropionate
2,3-Diaminopropionic acid
lipidmaps:LMFA01100051 2,3-diamino-propionic acid
2S,3-diamino-propionic acid
lipidmaps:LMFA01100051
metacyc:23-Diaminopropanoate 2,3-diaminopropanoate
2,3-diaminopropanoic acid
2,3-diaminopropionate
2,3-diaminopropionic acid
2-amino-3-ammoniopropanoate
23-Diaminopropanoate
3-aminoalanine zwitterion
metacyc:L-23-DIAMINOPROPANOATE (S)-2,3-diaminopropanoate
(S)-2,3-diaminopropionate
3-amino-L-alanine
L-2,3-diaminopropanoate
L-2,3-diaminopropionate
L-23-DIAMINOPROPANOATE
sabiork:6603
seed:cpd02150
L-2,3-Diaminopropanoate
L-2,3-Diaminopropanoic acid
L-2,3-Diaminopropionate
L-2,3-Diaminopropionic acid
seed:cpd03828 2,3-Diaminopropanoate
2,3-Diaminopropanoic acid
2,3-Diaminopropionate
2,3-Diaminopropionic acid
23dappa
seed:cpd21925 23-Diaminopropanoate