Feedback

 

(2S)-2-isopropylmalate

Image of MNXM985
Properties
MNX_IDMNXM985
formulaC7H10O5
charge-2
mass174.1524
referencechebi:1178
InChIKeyBITYXLXUCSKTJS-ZETCQYMHSA-L
InChIInChI=1S/C7H12O5/c1-4(2)7(12,6(10)11)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11)/p-2/t7-/m0/s1
SMILESCC(C)[C@@](O)(CC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (2S)-2-isopropylmalate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3c3hmp 3-Carboxy-3-hydroxy-4-methylpentanoate
chebi:1178 (2S)-2-Isopropylmalate
(2S)-2-hydroxy-2-(propan-2-yl)butanedioate
(2S)-2-isopropylmalate
(2S)-2-isopropylmalate(2-)
BITYXLXUCSKTJS-ZETCQYMHSA-L
chebi:35128 (2S)-2-Hydroxy-2-isopropylsuccinic acid
(2S)-2-Isopropylmalate
(2S)-2-hydroxy-2-(propan-2-yl)butanedioic acid
(2S)-2-hydroxy-2-isopropylsuccinic acid
(2S)-2-isopropylmalic acid
(3S)-3-carboxy-3-hydroxy-4-methylpentanoic acid
(3S)-3-carboxy-3-hydroxyisocaproic acid
(S)-2-Hydroxy-2-(isopropyl)succinic acid
2-Isopropylmalic acid
3-Carboxy-3-hydroxy-4-methylpentanoate
3-Carboxy-3-hydroxyisocaproate
BITYXLXUCSKTJS-ZETCQYMHSA-N
kegg:C02504 (2S)-2-Hydroxy-2-isopropylsuccinic acid
(2S)-2-Isopropylmalate
2-Isopropylmalic acid
3-Carboxy-3-hydroxy-4-methylpentanoate
3-Carboxy-3-hydroxyisocaproate
alpha-Isopropylmalate
lipidmaps:LMFA01170083 (2S)-2-isopropyl-2-hydroxy-butanedioic acid
2-isopropyl-malic acid
lipidmaps:LMFA01170083
metacyc:3-CARBOXY-3-HYDROXY-ISOCAPROATE (2S)-2-isopropylmalate
3-CARBOXY-3-HYDROXY-ISOCAPROATE
3-carboxy-3-hydroxy-4-methylpentanoate
3-carboxy-3-hydroxy-isocaproate
3-hydroxy-4-methyl-3-carboxypentanoate
alpha-isopropylmalate
seed:cpd01646 (2S)-2-Isopropylmalate
2-Hydroxy-2-isopropylbutanedioate
2-Isopropylmalate
2-Isopropylmalic acid
3-Carboxy-3-hydroxy-4-methylpentanoate
3-Carboxy-3-hydroxy-isocaproate
3-Carboxy-3-hydroxyisocaproate
3-Hydroxy-4-methyl-3-carboxypentanoate
3c3hmp