Feedback

 

4-aminobutanoate

Image of MNXM192
Properties
MNX_IDMNXM192
formulaC4H9NO2
charge0
mass103.1198
referencechebi:59888
InChIKeyBTCSSZJGUNDROE-UHFFFAOYSA-N
InChIInChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
SMILES[NH3+]CCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of 4-aminobutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:4abut 4-Aminobutanoate
chebi:16865
chebi:1786
chebi:193777
chebi:20318
chebi:40483
4-Aminobutanoic acid
4-Aminobutyric acid
4-aminobutanoic acid
4-aminobutyric acid
4Abu
BTCSSZJGUNDROE-UHFFFAOYSA-N
GABA
GAMMA-AMINO-BUTANOIC ACID
gamma-Aminobuttersaeure
gamma-Aminobutyric acid
gamma-amino-n-butyric acid
gamma-aminobutanoic acid
gamma-aminobutyric acid
omega-aminobutyric acid
piperidic acid
piperidinic acid
chebi:11961
chebi:20317
chebi:30566
4-Amino-butyrat
4-Aminobutylate
4-aminobutanoate
4-aminobutanoic acid ion (1-)
4-aminobutyrate
BTCSSZJGUNDROE-UHFFFAOYSA-M
gamma-aminobutanoate
gamma-aminobutyrate
gamma-aminobutyrate anion
chebi:59888 4-aminobutanoate
4-ammoniobutanoate
4-azaniumylbutanoate
BTCSSZJGUNDROE-UHFFFAOYSA-N
gamma-aminobutyric acid zwitterion
envipath:...b83421426cbb 4-aminobutanoate
hmdb:HMDB00112 4-aminobutanoic acid
Gamma-Aminobutyric acid
gamma(amino)-butyric acid
kegg:C00334
kegg:D00058
4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutyrate
4-Aminobutyric acid
GABA
Gammalon (TN)
gamma-Aminobutyric acid
gamma-Aminobutyric acid (JAN)
lipidmaps:LMFA01100039 4-Aminobutanoic acid
4-amino-butanoic acid
lipidmaps:LMFA01100039
metacyc:4-AMINO-BUTYRATE 4-AMINO-BUTYRATE
4-NH2-but
4-NH3-but
4-amino-n-butyric acid
4-aminobutanoate
4-aminobutyric acid
GABA
g-amino-n-butyric acid
gamma-amino-N-butyrate
gamma-amino-n-butyric acid
gamma-aminobutyrate
reactome:352003
reactome:352011
reactome:428571
GABA
gamma-aminobutyrate
gamma-aminobutyric acid
gamma-aminobutyric acid zwitterion
reactome:916850 GABA
gamma-aminobutyric acid
gamma-aminobutyric acid zwitterion
sabiork:2021 4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutylate
4-Aminobutyrate
4-Aminobutyric acid
gamma-Aminobutyrate
gamma-Aminobutyric acid
seed:cpd00281 4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutylate
4-Aminobutyrate
4-Aminobutyric acid
4abut
GABA
gamma-Aminobutyric acid
deprecated:MNXM89711