Feedback

7S,10S-diHOME

PropertiesImageOccurences in reactions
MNX_IDMNXM102211Image of MNXM102211
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC18H34O4
charge0
mass314.24571
referencechebi:165759
InChIKeyIPRLELFMTNDNMN-WLFRDLTRSA-N
InChIInChI=1S/C18H34O4/c1-2-3-4-5-6-8-11-16(19)14-15-17(20)12-9-7-10-13-18(21)22/h14-17,19-20H,2-13H2,1H3,(H,21,22)/b15-14+/t16-,17-/m0/s1
SMILESCCCCCCCC[C@H](O)/C=C/[C@@H](O)CCCCCC(=O)O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:165759
chebi:165759
7S,10S-diHOME
(E,7S,10S)-7,10-dihydroxyoctadec-8-enoic acid
lipidmaps:LMFA02000327
lipidmapsM:LMFA02000327
7,10-dihydroxy-8E-octadecenoic acid
7,10-dihydroxy-8E-octadecenoic acid
FA 18:1
O2
lipidmaps:LMFA02000060
lipidmapsM:LMFA02000060
7S,10S-diHOME
7S,10S-dihydroxy-8E-octadecenoic acid
FA 18:1
O2