Feedback

Akebonic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM102443Image of MNXM102443
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC29H44O3
charge0
mass440.32905
referencechebi:69588
InChIKeyXWVVPZWKCNXREE-VSQYQUPVSA-N
InChIInChI=1S/C29H44O3/c1-18-9-14-29(24(31)32)16-15-27(5)19(20(29)17-18)7-8-22-26(4)12-11-23(30)25(2,3)21(26)10-13-28(22,27)6/h7,20-23,30H,1,8-17H2,2-6H3,(H,31,32)/t20-,21-,22+,23-,26-,27+,28+,29-/m0/s1
SMILESC=C1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:69588
chebi:69588
Akebonic acid