Feedback

aspergillide B

PropertiesImageOccurences in reactions
MNX_IDMNXM102867Image of MNXM102867
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC14H22O4
charge0
mass254.15181
referencechebi:65451
InChIKeyFDJDTDDUDZAAFP-NPZYAQMBSA-N
InChIInChI=1S/C14H22O4/c1-10-5-3-2-4-6-11-7-8-12(15)13(18-11)9-14(16)17-10/h4,6,10-13,15H,2-3,5,7-9H2,1H3/b6-4+/t10-,11-,12-,13-/m0/s1
SMILESC[C@H]1CCC/C=C/[C@H]2CC[C@H](O)[C@H](CC(=O)O1)O2
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:65451
chebi:65451
aspergillide B
(1S,5S,9E,11R,14S)-14-hydroxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one