Feedback

bauhinoxepin F

PropertiesImageOccurences in reactions
MNX_IDMNXM102992Image of MNXM102992
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC17H18O5
charge0
mass302.11542
referencechebi:65470
InChIKeyXVMLDDFWHNGJME-UHFFFAOYSA-N
InChIInChI=1S/C17H18O5/c1-9-14(19)16(21-3)11-8-7-10-12(18)5-4-6-13(10)22-17(11)15(9)20-2/h4-6,18-19H,7-8H2,1-3H3
SMILESCOc1c(O)c(C)c(OC)c2c1CCc1c(O)cccc1O2
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:65470
chebi:65470
bauhinoxepin F
5,6-dihydro-3,7-dihydroxy-1,4-methoxy-2-methyldibenz[b,f]oxepin
6,9-dimethoxy-7-methyl-10,11-dihydrodibenzo[b,f]oxepine-1,8-diol