Feedback

bistratamide G

PropertiesImageOccurences in reactions
MNX_IDMNXM103226Image of MNXM103226
#reac
in my sandbox 0
in MNXref (generic)0
in models (compartimentalized) 0
formulaC25H32N6O5S
charge0
mass528.21549
referencechebi:65506
InChIKeyYDONFAWPMVOOTI-BZSNNMDCSA-N
InChIInChI=1S/C25H32N6O5S/c1-10(2)16-23-26-14(8-35-23)20(32)30-18(12(5)6)25-27-15(9-37-25)21(33)28-17(11(3)4)24-31-19(13(7)36-24)22(34)29-16/h8-12,16-18H,1-7H3,(H,28,33)(H,29,34)(H,30,32)/t16-,17-,18-/m0/s1
SMILESCc1oc2nc1C(=O)N[C@@H](C(C)C)c1nc(co1)C(=O)N[C@@H](C(C)C)c1nc(cs1)C(=O)N[C@H]2C(C)C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:65506
chebi:65506
bistratamide G
(4S,11S,18S)-7-methyl-4,11,18-tri(propan-2-yl)-6,13-dioxa-20-thia-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.1(5,8).1(12,15)12,15]tetracosa-1(21),5(24),7,12(23),14,19(22)-hexaene-2,9,16-trione